Difference between revisions of "CPD-13397"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13397 CPD-13397] == * smiles: ** CC([N+])C(=O)NC(C(O)C)C([O-])=O * common name: ** L-alanyl...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC([N+])C(=O)NC(C(O)C)C([O-])=O | ** CC([N+])C(=O)NC(C(O)C)C([O-])=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 190.199 | ** 190.199 | ||
| + | * inchi key: | ||
| + | ** InChIKey=BUQICHWNXBIBOG-LMVFSUKVSA-N | ||
| + | * common name: | ||
| + | ** L-alanyl-L-threonine | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** Ala-Thr |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * | + | * METABOLIGHTS : MTBLC74390 |
| − | + | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74390 74390] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74390 74390] | ||
| − | * | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7006473 7006473] | ||
{{#set: smiles=CC([N+])C(=O)NC(C(O)C)C([O-])=O}} | {{#set: smiles=CC([N+])C(=O)NC(C(O)C)C([O-])=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=190.199 }} | {{#set: molecular weight=190.199 }} | ||
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=BUQICHWNXBIBOG-LMVFSUKVSA-N}} |
| + | {{#set: common name=L-alanyl-L-threonine}} | ||
| + | {{#set: common name=Ala-Thr}} | ||
{{#set: consumed by=RXN0-6980}} | {{#set: consumed by=RXN0-6980}} | ||
Latest revision as of 15:06, 10 January 2019
Contents
Metabolite CPD-13397
- smiles:
- CC([N+])C(=O)NC(C(O)C)C([O-])=O
- molecular weight:
- 190.199
- inchi key:
- InChIKey=BUQICHWNXBIBOG-LMVFSUKVSA-N
- common name:
- L-alanyl-L-threonine
- Synonym(s):
- Ala-Thr
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC([N+])C(=O)NC(C(O)C)C([O-])=O" cannot be used as a page name in this wiki.
