Difference between revisions of "CPD66-29"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-29 CPD66-29] == * smiles: ** CC24(CCC(=O)CC(=CC[CH]1([CH]3(CCC(=O)C(CC[CH]12)(C)3)))4) *...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC24(CCC(=O)CC(=CC[CH]1([CH]3(CCC(=O)C(CC[CH]12)(C)3)))4) | ** CC24(CCC(=O)CC(=CC[CH]1([CH]3(CCC(=O)C(CC[CH]12)(C)3)))4) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 286.413 | ** 286.413 | ||
| + | * inchi key: | ||
| + | ** InChIKey=SQGZFRITSMYKRH-QAGGRKNESA-N | ||
| + | * common name: | ||
| + | ** 5-androstene-3,17-dione | ||
* Synonym(s): | * Synonym(s): | ||
** androst-5-ene-3,17-dione | ** androst-5-ene-3,17-dione | ||
| Line 14: | Line 14: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN66-342]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.543261.html 543261] | ** [http://www.chemspider.com/Chemical-Structure.543261.html 543261] | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83865 83865] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83865 83865] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C20252 C20252] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=160531 160531] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=160531 160531] | ||
{{#set: smiles=CC24(CCC(=O)CC(=CC[CH]1([CH]3(CCC(=O)C(CC[CH]12)(C)3)))4)}} | {{#set: smiles=CC24(CCC(=O)CC(=CC[CH]1([CH]3(CCC(=O)C(CC[CH]12)(C)3)))4)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=286.413 }} | {{#set: molecular weight=286.413 }} | ||
| + | {{#set: inchi key=InChIKey=SQGZFRITSMYKRH-QAGGRKNESA-N}} | ||
| + | {{#set: common name=5-androstene-3,17-dione}} | ||
{{#set: common name=androst-5-ene-3,17-dione}} | {{#set: common name=androst-5-ene-3,17-dione}} | ||
| − | {{#set: | + | {{#set: reversible reaction associated=RXN66-342}} |
Latest revision as of 15:07, 10 January 2019
Contents
Metabolite CPD66-29
- smiles:
- CC24(CCC(=O)CC(=CC[CH]1([CH]3(CCC(=O)C(CC[CH]12)(C)3)))4)
- molecular weight:
- 286.413
- inchi key:
- InChIKey=SQGZFRITSMYKRH-QAGGRKNESA-N
- common name:
- 5-androstene-3,17-dione
- Synonym(s):
- androst-5-ene-3,17-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC24(CCC(=O)CC(=CC[CH]1([CH]3(CCC(=O)C(CC[CH]12)(C)3)))4)" cannot be used as a page name in this wiki.
