Difference between revisions of "CPD-18733"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18733 CPD-18733] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCC2(O)(C1(C=CC=CC=1[N+](=C(C)C(=O)2...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)=CCCC(C)=CCCC(C)=CCC2(O)(C1(C=CC=CC=1[N+](=C(C)C(=O)2)[O-])) | ** CC(C)=CCCC(C)=CCCC(C)=CCC2(O)(C1(C=CC=CC=1[N+](=C(C)C(=O)2)[O-])) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 395.541 | ** 395.541 | ||
+ | * inchi key: | ||
+ | ** InChIKey=RNXNMMDMLFJCKP-YEFHWUCQSA-N | ||
+ | * common name: | ||
+ | ** 4-hydroxy-2-methyl-3-oxo-4-farnesyl-3,4-dihydroquinoline-1-oxide | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
* [[RXN-17335]] | * [[RXN-17335]] | ||
+ | * [[RXN-17334]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=90785 90785] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=118797928 118797928] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C21141 C21141] | ||
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCC2(O)(C1(C=CC=CC=1[N+](=C(C)C(=O)2)[O-]))}} | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCC2(O)(C1(C=CC=CC=1[N+](=C(C)C(=O)2)[O-]))}} | ||
− | |||
− | |||
{{#set: molecular weight=395.541 }} | {{#set: molecular weight=395.541 }} | ||
− | {{#set: produced by=RXN- | + | {{#set: inchi key=InChIKey=RNXNMMDMLFJCKP-YEFHWUCQSA-N}} |
+ | {{#set: common name=4-hydroxy-2-methyl-3-oxo-4-farnesyl-3,4-dihydroquinoline-1-oxide}} | ||
+ | {{#set: produced by=RXN-17335|RXN-17334}} |
Latest revision as of 15:11, 10 January 2019
Contents
[hide]Metabolite CPD-18733
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCC2(O)(C1(C=CC=CC=1[N+](=C(C)C(=O)2)[O-]))
- molecular weight:
- 395.541
- inchi key:
- InChIKey=RNXNMMDMLFJCKP-YEFHWUCQSA-N
- common name:
- 4-hydroxy-2-methyl-3-oxo-4-farnesyl-3,4-dihydroquinoline-1-oxide
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)=CCCC(C)=CCC2(O)(C1(C=CC=CC=1[N+](=C(C)C(=O)2)[O-]))" cannot be used as a page name in this wiki.