Difference between revisions of "CPD-18539"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18539 CPD-18539] == * smiles: ** [CH](=O)NC1(C=CC=CC=1C(=O)C(O)C([N+])C(=O)[O-]) * common n...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** [CH](=O)NC1(C=CC=CC=1C(=O)C(O)C([N+])C(=O)[O-]) | ** [CH](=O)NC1(C=CC=CC=1C(=O)C(O)C([N+])C(=O)[O-]) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 252.226 | ** 252.226 | ||
| + | * inchi key: | ||
| + | ** InChIKey=GADDUKLGJYJXSL-WCBMZHEXSA-N | ||
| + | * common name: | ||
| + | ** (R)-N-formyl-β-hydroxy-L-kynurenine | ||
* Synonym(s): | * Synonym(s): | ||
| Line 19: | Line 19: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515270 102515270] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515270 102515270] | ||
{{#set: smiles=[CH](=O)NC1(C=CC=CC=1C(=O)C(O)C([N+])C(=O)[O-])}} | {{#set: smiles=[CH](=O)NC1(C=CC=CC=1C(=O)C(O)C([N+])C(=O)[O-])}} | ||
| − | |||
| − | |||
{{#set: molecular weight=252.226 }} | {{#set: molecular weight=252.226 }} | ||
| + | {{#set: inchi key=InChIKey=GADDUKLGJYJXSL-WCBMZHEXSA-N}} | ||
| + | {{#set: common name=(R)-N-formyl-β-hydroxy-L-kynurenine}} | ||
{{#set: consumed by=RXN-17150}} | {{#set: consumed by=RXN-17150}} | ||
Latest revision as of 15:24, 10 January 2019
Contents
Metabolite CPD-18539
- smiles:
- [CH](=O)NC1(C=CC=CC=1C(=O)C(O)C([N+])C(=O)[O-])
- molecular weight:
- 252.226
- inchi key:
- InChIKey=GADDUKLGJYJXSL-WCBMZHEXSA-N
- common name:
- (R)-N-formyl-β-hydroxy-L-kynurenine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CH](=O)NC1(C=CC=CC=1C(=O)C(O)C([N+])C(=O)[O-])" cannot be used as a page name in this wiki.
