Difference between revisions of "3-KETO-ADIPYL-COA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPYL-COA 3-KETO-ADIPYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 904.605 | ** 904.605 | ||
+ | * inchi key: | ||
+ | ** InChIKey=VKKKAAPGXHWXOO-BIEWRJSYSA-I | ||
+ | * common name: | ||
+ | ** 3-oxoadipyl-CoA | ||
* Synonym(s): | * Synonym(s): | ||
** 3-ketoadipyl-CoA | ** 3-ketoadipyl-CoA | ||
Line 19: | Line 19: | ||
* [[RXN0-2044]] | * [[RXN0-2044]] | ||
== External links == | == External links == | ||
+ | * REFMET : 3-oxoadipyl-CoA | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266578 45266578] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266578 45266578] | ||
Line 27: | Line 28: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C02232 C02232] | ** [http://www.genome.jp/dbget-bin/www_bget?C02232 C02232] | ||
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
− | |||
− | |||
{{#set: molecular weight=904.605 }} | {{#set: molecular weight=904.605 }} | ||
+ | {{#set: inchi key=InChIKey=VKKKAAPGXHWXOO-BIEWRJSYSA-I}} | ||
+ | {{#set: common name=3-oxoadipyl-CoA}} | ||
{{#set: common name=3-ketoadipyl-CoA|3-keto-adipyl-coa|β-ketoadipyl-CoA}} | {{#set: common name=3-ketoadipyl-CoA|3-keto-adipyl-coa|β-ketoadipyl-CoA}} | ||
{{#set: reversible reaction associated=RXN0-2044}} | {{#set: reversible reaction associated=RXN0-2044}} |
Latest revision as of 16:24, 10 January 2019
Contents
Metabolite 3-KETO-ADIPYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 904.605
- inchi key:
- InChIKey=VKKKAAPGXHWXOO-BIEWRJSYSA-I
- common name:
- 3-oxoadipyl-CoA
- Synonym(s):
- 3-ketoadipyl-CoA
- 3-keto-adipyl-coa
- β-ketoadipyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.