Difference between revisions of "TROPINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINE TROPINE] == * smiles: ** C[N+]1(C2(CCC1CC(O)C2)) * common name: ** tropine * inchi key:...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C[N+]1(C2(CCC1CC(O)C2)) | ** C[N+]1(C2(CCC1CC(O)C2)) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 142.22 | ** 142.22 | ||
| + | * inchi key: | ||
| + | ** InChIKey=CYHOMWAPJJPNMW-JIGDXULJSA-O | ||
| + | * common name: | ||
| + | ** tropine | ||
* Synonym(s): | * Synonym(s): | ||
| Line 16: | Line 16: | ||
* [[TROPINE-DEHYDROGENASE-RXN]] | * [[TROPINE-DEHYDROGENASE-RXN]] | ||
== External links == | == External links == | ||
| + | * NCI: | ||
| + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=43870 43870] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57554 57554] | ||
* CAS : 120-29-6 | * CAS : 120-29-6 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C00729 C00729] | ** [http://www.genome.jp/dbget-bin/www_bget?C00729 C00729] | ||
| − | |||
| − | |||
| − | |||
| − | |||
{{#set: smiles=C[N+]1(C2(CCC1CC(O)C2))}} | {{#set: smiles=C[N+]1(C2(CCC1CC(O)C2))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=142.22 }} | {{#set: molecular weight=142.22 }} | ||
| + | {{#set: inchi key=InChIKey=CYHOMWAPJJPNMW-JIGDXULJSA-O}} | ||
| + | {{#set: common name=tropine}} | ||
{{#set: reversible reaction associated=TROPINE-DEHYDROGENASE-RXN}} | {{#set: reversible reaction associated=TROPINE-DEHYDROGENASE-RXN}} | ||
Latest revision as of 15:29, 10 January 2019
Contents
Metabolite TROPINE
- smiles:
- C[N+]1(C2(CCC1CC(O)C2))
- molecular weight:
- 142.22
- inchi key:
- InChIKey=CYHOMWAPJJPNMW-JIGDXULJSA-O
- common name:
- tropine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[N+]1(C2(CCC1CC(O)C2))" cannot be used as a page name in this wiki.
