Difference between revisions of "CPD-367"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-367 CPD-367] == * smiles: ** C(=O)([O-])C(O)CS([O-])(=O)=O * common name: ** (2R)-3-sulfola...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(=O)([O-])C(O)CS([O-])(=O)=O | ** C(=O)([O-])C(O)CS([O-])(=O)=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 168.121 | ** 168.121 | ||
| + | * inchi key: | ||
| + | ** InChIKey=CQQGIWJSICOUON-REOHCLBHSA-L | ||
| + | * common name: | ||
| + | ** (2R)-3-sulfolactate | ||
* Synonym(s): | * Synonym(s): | ||
** (R)-3-sulfolactic acid | ** (R)-3-sulfolactic acid | ||
| Line 21: | Line 21: | ||
* [[R230-RXN]] | * [[R230-RXN]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58738 58738] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58738 58738] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246047 25246047] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C11537 C11537] | ** [http://www.genome.jp/dbget-bin/www_bget?C11537 C11537] | ||
{{#set: smiles=C(=O)([O-])C(O)CS([O-])(=O)=O}} | {{#set: smiles=C(=O)([O-])C(O)CS([O-])(=O)=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=168.121 }} | {{#set: molecular weight=168.121 }} | ||
| + | {{#set: inchi key=InChIKey=CQQGIWJSICOUON-REOHCLBHSA-L}} | ||
| + | {{#set: common name=(2R)-3-sulfolactate}} | ||
{{#set: common name=(R)-3-sulfolactic acid|(R)-sulfolactate|(2R)-2-hydroxy-3-sulfopropanoate|D-sulfolactate}} | {{#set: common name=(R)-3-sulfolactic acid|(R)-sulfolactate|(2R)-2-hydroxy-3-sulfopropanoate|D-sulfolactate}} | ||
{{#set: produced by=RXN-11727}} | {{#set: produced by=RXN-11727}} | ||
{{#set: reversible reaction associated=R230-RXN}} | {{#set: reversible reaction associated=R230-RXN}} | ||
Latest revision as of 15:51, 10 January 2019
Contents
Metabolite CPD-367
- smiles:
- C(=O)([O-])C(O)CS([O-])(=O)=O
- molecular weight:
- 168.121
- inchi key:
- InChIKey=CQQGIWJSICOUON-REOHCLBHSA-L
- common name:
- (2R)-3-sulfolactate
- Synonym(s):
- (R)-3-sulfolactic acid
- (R)-sulfolactate
- (2R)-2-hydroxy-3-sulfopropanoate
- D-sulfolactate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])C(O)CS([O-])(=O)=O" cannot be used as a page name in this wiki.
