Difference between revisions of "CPD-4124"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4124 CPD-4124] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[C...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34)))) | ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34)))) | ||
| + | * molecular weight: | ||
| + | ** 426.724 | ||
* inchi key: | * inchi key: | ||
** InChIKey=LPZCCMIISIBREI-JXMPMKKESA-N | ** InChIKey=LPZCCMIISIBREI-JXMPMKKESA-N | ||
* common name: | * common name: | ||
** 24-ethylidenelophenol | ** 24-ethylidenelophenol | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** (Z)-24-ethylidenelophenol | ** (Z)-24-ethylidenelophenol | ||
| Line 19: | Line 19: | ||
* [[RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.]] | * [[RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=33203 33203] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=33203 33203] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9548595 9548595] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C11523 C11523] | ** [http://www.genome.jp/dbget-bin/www_bget?C11523 C11523] | ||
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))}} | {{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: molecular weight=426.724 }} | ||
{{#set: inchi key=InChIKey=LPZCCMIISIBREI-JXMPMKKESA-N}} | {{#set: inchi key=InChIKey=LPZCCMIISIBREI-JXMPMKKESA-N}} | ||
{{#set: common name=24-ethylidenelophenol}} | {{#set: common name=24-ethylidenelophenol}} | ||
| − | |||
{{#set: common name=(Z)-24-ethylidenelophenol|citrostadienol}} | {{#set: common name=(Z)-24-ethylidenelophenol|citrostadienol}} | ||
{{#set: produced by=2.1.1.143-RXN}} | {{#set: produced by=2.1.1.143-RXN}} | ||
{{#set: reversible reaction associated=RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.}} | {{#set: reversible reaction associated=RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.}} | ||
Latest revision as of 14:53, 10 January 2019
Contents
Metabolite CPD-4124
- smiles:
- CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))
- molecular weight:
- 426.724
- inchi key:
- InChIKey=LPZCCMIISIBREI-JXMPMKKESA-N
- common name:
- 24-ethylidenelophenol
- Synonym(s):
- (Z)-24-ethylidenelophenol
- citrostadienol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
