Difference between revisions of "CPD-13851"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O | ** C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 503.152 | ** 503.152 | ||
| + | * inchi key: | ||
| + | ** InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J | ||
| + | * common name: | ||
| + | ** 2-hydroxy-dATP | ||
* Synonym(s): | * Synonym(s): | ||
** 2-hydroxy-2'-deoxyadenosine 5'-triphosphate | ** 2-hydroxy-2'-deoxyadenosine 5'-triphosphate | ||
| Line 16: | Line 16: | ||
* [[RXN0-6957]] | * [[RXN0-6957]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77897 77897] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77897 77897] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289402 86289402] | ||
{{#set: smiles=C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O}} | {{#set: smiles=C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=503.152 }} | {{#set: molecular weight=503.152 }} | ||
| + | {{#set: inchi key=InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J}} | ||
| + | {{#set: common name=2-hydroxy-dATP}} | ||
{{#set: common name=2-hydroxy-2'-deoxyadenosine 5'-triphosphate|2'-deoxyisoguanosine triphosphate}} | {{#set: common name=2-hydroxy-2'-deoxyadenosine 5'-triphosphate|2'-deoxyisoguanosine triphosphate}} | ||
{{#set: consumed by=RXN0-6957}} | {{#set: consumed by=RXN0-6957}} | ||
| − | |||
Latest revision as of 14:54, 10 January 2019
Contents
Metabolite CPD-13851
- smiles:
- C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O
- molecular weight:
- 503.152
- inchi key:
- InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J
- common name:
- 2-hydroxy-dATP
- Synonym(s):
- 2-hydroxy-2'-deoxyadenosine 5'-triphosphate
- 2'-deoxyisoguanosine triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.
