Difference between revisions of "CPD-5881"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] == * smiles: ** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2)) * common name:...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2)) | ** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2)) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 257.249 | ** 257.249 | ||
| + | * inchi key: | ||
| + | ** InChIKey=KJKIEFUPAPPGBC-XXKOCQOQSA-N | ||
| + | * common name: | ||
| + | ** (6R)-4a-hydroxy-tetrahydrobiopterin | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 4a-hydroxy-5,6,7,8-tetrahydrobiopterin |
| − | ** | + | ** 4a-hydroxy-tetrahydropterin |
| − | ** 6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro- | + | ** (6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4a-hydroxypterin |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| Line 19: | Line 19: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15642 15642] | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173804 46173804] |
* HMDB : HMDB02281 | * HMDB : HMDB02281 | ||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C15522 C15522] | ** [http://www.genome.jp/dbget-bin/www_bget?C15522 C15522] | ||
{{#set: smiles=CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))}} | {{#set: smiles=CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=257.249 }} | {{#set: molecular weight=257.249 }} | ||
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=KJKIEFUPAPPGBC-XXKOCQOQSA-N}} |
| + | {{#set: common name=(6R)-4a-hydroxy-tetrahydrobiopterin}} | ||
| + | {{#set: common name=4a-hydroxy-5,6,7,8-tetrahydrobiopterin|4a-hydroxy-tetrahydropterin|(6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4a-hydroxypterin}} | ||
{{#set: consumed by=RXN-7908}} | {{#set: consumed by=RXN-7908}} | ||
Latest revision as of 14:58, 10 January 2019
Contents
Metabolite CPD-5881
- smiles:
- CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))
- molecular weight:
- 257.249
- inchi key:
- InChIKey=KJKIEFUPAPPGBC-XXKOCQOQSA-N
- common name:
- (6R)-4a-hydroxy-tetrahydrobiopterin
- Synonym(s):
- 4a-hydroxy-5,6,7,8-tetrahydrobiopterin
- 4a-hydroxy-tetrahydropterin
- (6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4a-hydroxypterin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))" cannot be used as a page name in this wiki.
