Difference between revisions of "CPD-609"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-609 CPD-609] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C4(OC(C(O)C(O)4)N6(C=NC5(C(=O)NC(N)=NC=56))) | ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C4(OC(C(O)C(O)4)N6(C=NC5(C(=O)NC(N)=NC=56))) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 864.359 | ** 864.359 | ||
+ | * inchi key: | ||
+ | ** InChIKey=OLGWXCQXRSSQPO-MHARETSRSA-J | ||
+ | * common name: | ||
+ | ** P1,P4-bis(5'-guanosyl) tetraphosphate | ||
* Synonym(s): | * Synonym(s): | ||
** bis(5'-guanosyl) tetraphosphate | ** bis(5'-guanosyl) tetraphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[3.6.1.17-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57553 57553] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57553 57553] | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203522 25203522] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203522 25203522] | ||
+ | * HMDB : HMDB01340 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01261 C01261] | ||
+ | * BIGG : gp4g | ||
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C4(OC(C(O)C(O)4)N6(C=NC5(C(=O)NC(N)=NC=56)))}} | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C4(OC(C(O)C(O)4)N6(C=NC5(C(=O)NC(N)=NC=56)))}} | ||
− | |||
− | |||
{{#set: molecular weight=864.359 }} | {{#set: molecular weight=864.359 }} | ||
+ | {{#set: inchi key=InChIKey=OLGWXCQXRSSQPO-MHARETSRSA-J}} | ||
+ | {{#set: common name=P1,P4-bis(5'-guanosyl) tetraphosphate}} | ||
{{#set: common name=bis(5'-guanosyl) tetraphosphate}} | {{#set: common name=bis(5'-guanosyl) tetraphosphate}} | ||
− | {{#set: | + | {{#set: consumed by=3.6.1.17-RXN}} |
Latest revision as of 16:08, 10 January 2019
Contents
Metabolite CPD-609
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C4(OC(C(O)C(O)4)N6(C=NC5(C(=O)NC(N)=NC=56)))
- molecular weight:
- 864.359
- inchi key:
- InChIKey=OLGWXCQXRSSQPO-MHARETSRSA-J
- common name:
- P1,P4-bis(5'-guanosyl) tetraphosphate
- Synonym(s):
- bis(5'-guanosyl) tetraphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C4(OC(C(O)C(O)4)N6(C=NC5(C(=O)NC(N)=NC=56)))" cannot be used as a page name in this wiki.