Difference between revisions of "CPDQT-37"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-37 CPDQT-37] == * smiles: ** CSCCCCC(C(O)C(=O)[O-])C(=O)[O-] * common name: ** 3-(4'-meth...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CSCCCCC(C(O)C(=O)[O-])C(=O)[O-] | ** CSCCCCC(C(O)C(=O)[O-])C(=O)[O-] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 234.267 | ** 234.267 | ||
| + | * inchi key: | ||
| + | ** InChIKey=ZIZLDVKLMYVMNX-UHFFFAOYSA-L | ||
| + | * common name: | ||
| + | ** 3-[(4'-methylthio)butyl]malate | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** 3-(4'-methylthio) | + | ** 3-[(4'-methylthio)butyl]malic acid |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| Line 21: | Line 21: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237164 44237164] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237164 44237164] | ||
{{#set: smiles=CSCCCCC(C(O)C(=O)[O-])C(=O)[O-]}} | {{#set: smiles=CSCCCCC(C(O)C(=O)[O-])C(=O)[O-]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=234.267 }} | {{#set: molecular weight=234.267 }} | ||
| − | {{#set: common name=3-(4'-methylthio) | + | {{#set: inchi key=InChIKey=ZIZLDVKLMYVMNX-UHFFFAOYSA-L}} |
| + | {{#set: common name=3-[(4'-methylthio)butyl]malate}} | ||
| + | {{#set: common name=3-[(4'-methylthio)butyl]malic acid}} | ||
{{#set: consumed by=RXNQT-4168}} | {{#set: consumed by=RXNQT-4168}} | ||
{{#set: reversible reaction associated=RXN-18206}} | {{#set: reversible reaction associated=RXN-18206}} | ||
Latest revision as of 15:10, 10 January 2019
Contents
Metabolite CPDQT-37
- smiles:
- CSCCCCC(C(O)C(=O)[O-])C(=O)[O-]
- molecular weight:
- 234.267
- inchi key:
- InChIKey=ZIZLDVKLMYVMNX-UHFFFAOYSA-L
- common name:
- 3-[(4'-methylthio)butyl]malate
- Synonym(s):
- 3-[(4'-methylthio)butyl]malic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CSCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.
"3-[(4'-methylthio)butyl]malate" cannot be used as a page name in this wiki.
"3-[(4'-methylthio)butyl]malic acid" cannot be used as a page name in this wiki.
