Difference between revisions of "CPD-14407"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14407 CPD-14407] == * smiles: ** CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ** CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 1051.975 | ** 1051.975 | ||
+ | * inchi key: | ||
+ | ** InChIKey=FJWJALRUNNZIBB-DDQUOPDJSA-J | ||
+ | * common name: | ||
+ | ** dihomo γ-linolenoyl-CoA | ||
* Synonym(s): | * Synonym(s): | ||
** (8Z,11Z,14Z)-icosatrienoyl-CoA | ** (8Z,11Z,14Z)-icosatrienoyl-CoA | ||
Line 15: | Line 15: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
* [[RXN-13435]] | * [[RXN-13435]] | ||
+ | * [[RXN-16044]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN-17105]] | * [[RXN-17105]] | ||
+ | * [[RXN-12971]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74264 74264] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74264 74264] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581179 71581179] | ||
{{#set: smiles=CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | {{#set: smiles=CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
− | |||
− | |||
{{#set: molecular weight=1051.975 }} | {{#set: molecular weight=1051.975 }} | ||
+ | {{#set: inchi key=InChIKey=FJWJALRUNNZIBB-DDQUOPDJSA-J}} | ||
+ | {{#set: common name=dihomo γ-linolenoyl-CoA}} | ||
{{#set: common name=(8Z,11Z,14Z)-icosatrienoyl-CoA|(8Z,11Z,14Z)-icosa-8,11,14-trienoyl-CoA|(8Z,11Z,14Z)-eicosa-8,11,14-trienoyl-CoA}} | {{#set: common name=(8Z,11Z,14Z)-icosatrienoyl-CoA|(8Z,11Z,14Z)-icosa-8,11,14-trienoyl-CoA|(8Z,11Z,14Z)-eicosa-8,11,14-trienoyl-CoA}} | ||
− | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-13435|RXN-16044}} |
− | {{#set: produced by=RXN-17105}} | + | {{#set: produced by=RXN-17105|RXN-12971}} |
Latest revision as of 15:11, 10 January 2019
Contents
Metabolite CPD-14407
- smiles:
- CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 1051.975
- inchi key:
- InChIKey=FJWJALRUNNZIBB-DDQUOPDJSA-J
- common name:
- dihomo γ-linolenoyl-CoA
- Synonym(s):
- (8Z,11Z,14Z)-icosatrienoyl-CoA
- (8Z,11Z,14Z)-icosa-8,11,14-trienoyl-CoA
- (8Z,11Z,14Z)-eicosa-8,11,14-trienoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.