Difference between revisions of "THIOMORPHOLINE-3-CARBOXYLATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIOMORPHOLINE-3-CARBOXYLATE THIOMORPHOLINE-3-CARBOXYLATE] == * smiles: ** C1(SCC(C([O-])=O)[N+...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(SCC(C([O-])=O)[N+]C1) | ** C1(SCC(C([O-])=O)[N+]C1) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 147.192 | ** 147.192 | ||
+ | * inchi key: | ||
+ | ** InChIKey=JOKIQGQOKXGHDV-UHFFFAOYSA-N | ||
+ | * common name: | ||
+ | ** thiomorpholine-3-carboxylate | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
* [[1.5.1.25-RXN]] | * [[1.5.1.25-RXN]] | ||
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58047 58047] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58047 58047] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202002 25202002] | ||
+ | * CAS : 20960-92-3 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C03901 C03901] | ** [http://www.genome.jp/dbget-bin/www_bget?C03901 C03901] | ||
+ | * HMDB : HMDB59611 | ||
{{#set: smiles=C1(SCC(C([O-])=O)[N+]C1)}} | {{#set: smiles=C1(SCC(C([O-])=O)[N+]C1)}} | ||
− | |||
− | |||
{{#set: molecular weight=147.192 }} | {{#set: molecular weight=147.192 }} | ||
− | {{#set: | + | {{#set: inchi key=InChIKey=JOKIQGQOKXGHDV-UHFFFAOYSA-N}} |
+ | {{#set: common name=thiomorpholine-3-carboxylate}} | ||
+ | {{#set: produced by=1.5.1.25-RXN}} |
Latest revision as of 15:14, 10 January 2019
Contents
Metabolite THIOMORPHOLINE-3-CARBOXYLATE
- smiles:
- C1(SCC(C([O-])=O)[N+]C1)
- molecular weight:
- 147.192
- inchi key:
- InChIKey=JOKIQGQOKXGHDV-UHFFFAOYSA-N
- common name:
- thiomorpholine-3-carboxylate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(SCC(C([O-])=O)[N+]C1)" cannot be used as a page name in this wiki.