Difference between revisions of "CPD-15689"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15689 CPD-15689] == * smiles: ** CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ** CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 941.776 | ** 941.776 | ||
+ | * inchi key: | ||
+ | ** InChIKey=ZSJRXHRCABOSNC-UOVVPLBNSA-J | ||
+ | * common name: | ||
+ | ** (2E,5E)-dodeca-2,5-dienoyl-CoA | ||
* Synonym(s): | * Synonym(s): | ||
− | ** 2E, 5E-dodecadienoyl-CoA | + | ** (2E,5E)-dodecadienoyl-CoA |
+ | ** 2-trans, 5-trans-dodecadienoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
Line 20: | Line 21: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658297 90658297] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658297 90658297] | ||
{{#set: smiles=CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | {{#set: smiles=CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
− | |||
− | |||
{{#set: molecular weight=941.776 }} | {{#set: molecular weight=941.776 }} | ||
− | {{#set: common name=2E, 5E-dodecadienoyl-CoA}} | + | {{#set: inchi key=InChIKey=ZSJRXHRCABOSNC-UOVVPLBNSA-J}} |
+ | {{#set: common name=(2E,5E)-dodeca-2,5-dienoyl-CoA}} | ||
+ | {{#set: common name=(2E,5E)-dodecadienoyl-CoA|2-trans, 5-trans-dodecadienoyl-CoA}} | ||
{{#set: consumed by=RXN-14801}} | {{#set: consumed by=RXN-14801}} |
Latest revision as of 16:14, 10 January 2019
Contents
Metabolite CPD-15689
- smiles:
- CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 941.776
- inchi key:
- InChIKey=ZSJRXHRCABOSNC-UOVVPLBNSA-J
- common name:
- (2E,5E)-dodeca-2,5-dienoyl-CoA
- Synonym(s):
- (2E,5E)-dodecadienoyl-CoA
- 2-trans, 5-trans-dodecadienoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.