Difference between revisions of "CPD-19339"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19339 CPD-19339] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)C(CO)(O)O1) * common nam...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)C(CO)(O)O1) | ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)C(CO)(O)O1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 288.147 | ** 288.147 | ||
| + | * inchi key: | ||
| + | ** InChIKey=CBIDVWSRUUODHL-OVHBTUCOSA-L | ||
| + | * common name: | ||
| + | ** α-D-sedoheptulopyranose 7-phosphate | ||
* Synonym(s): | * Synonym(s): | ||
| Line 16: | Line 16: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=133984 133984] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=122391286 122391286] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C20956 C20956] | ** [http://www.genome.jp/dbget-bin/www_bget?C20956 C20956] | ||
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)C(CO)(O)O1)}} | {{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)C(CO)(O)O1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=288.147 }} | {{#set: molecular weight=288.147 }} | ||
| + | {{#set: inchi key=InChIKey=CBIDVWSRUUODHL-OVHBTUCOSA-L}} | ||
| + | {{#set: common name=α-D-sedoheptulopyranose 7-phosphate}} | ||
{{#set: consumed by=RXN-9140}} | {{#set: consumed by=RXN-9140}} | ||
Latest revision as of 15:16, 10 January 2019
Contents
Metabolite CPD-19339
- smiles:
- C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)C(CO)(O)O1)
- molecular weight:
- 288.147
- inchi key:
- InChIKey=CBIDVWSRUUODHL-OVHBTUCOSA-L
- common name:
- α-D-sedoheptulopyranose 7-phosphate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)C(CO)(O)O1)" cannot be used as a page name in this wiki.
