Difference between revisions of "CPD-464"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(O...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C | ** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 719.897 | ** 719.897 | ||
+ | * inchi key: | ||
+ | ** InChIKey=RVCNKTPCHZNAAO-IMSLGMFESA-K | ||
+ | * common name: | ||
+ | ** prephytoene diphosphate | ||
* Synonym(s): | * Synonym(s): | ||
** (1R,2R,3R)-prephytoene diphosphate | ** (1R,2R,3R)-prephytoene diphosphate | ||
Line 19: | Line 19: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58011 58011] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58011 58011] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=122706259 122706259] | ||
+ | * HMDB : HMDB03023 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C03427 C03427] | ** [http://www.genome.jp/dbget-bin/www_bget?C03427 C03427] | ||
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C}} | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C}} | ||
− | |||
− | |||
{{#set: molecular weight=719.897 }} | {{#set: molecular weight=719.897 }} | ||
+ | {{#set: inchi key=InChIKey=RVCNKTPCHZNAAO-IMSLGMFESA-K}} | ||
+ | {{#set: common name=prephytoene diphosphate}} | ||
{{#set: common name=(1R,2R,3R)-prephytoene diphosphate}} | {{#set: common name=(1R,2R,3R)-prephytoene diphosphate}} | ||
{{#set: consumed by=RXNARA-8002|RXN-12245}} | {{#set: consumed by=RXNARA-8002|RXN-12245}} | ||
{{#set: produced by=2.5.1.32-RXN}} | {{#set: produced by=2.5.1.32-RXN}} |
Latest revision as of 16:21, 10 January 2019
Contents
Metabolite CPD-464
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C
- molecular weight:
- 719.897
- inchi key:
- InChIKey=RVCNKTPCHZNAAO-IMSLGMFESA-K
- common name:
- prephytoene diphosphate
- Synonym(s):
- (1R,2R,3R)-prephytoene diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C" cannot be used as a page name in this wiki.