Difference between revisions of "CPD-380"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-380 CPD-380] == * smiles: ** C(=O)([O-])C(=O)CS(=O)(=O)[O-] * common name: ** 3-sulfopyruva...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(=O)([O-])C(=O)CS(=O)(=O)[O-] | ** C(=O)([O-])C(=O)CS(=O)(=O)[O-] | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 166.105 | ** 166.105 | ||
+ | * inchi key: | ||
+ | ** InChIKey=BUTHMSUEBYPMKJ-UHFFFAOYSA-L | ||
+ | * common name: | ||
+ | ** 3-sulfopyruvate | ||
* Synonym(s): | * Synonym(s): | ||
** sulfopyruvate | ** sulfopyruvate | ||
Line 16: | Line 16: | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
* [[R230-RXN]] | * [[R230-RXN]] | ||
+ | * [[RXN-11737]] | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
* METABOLIGHTS : MTBLC57940 | * METABOLIGHTS : MTBLC57940 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245217 25245217] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245217 25245217] | ||
+ | * HMDB : HMDB04045 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57940 57940] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05528 C05528] | ||
{{#set: smiles=C(=O)([O-])C(=O)CS(=O)(=O)[O-]}} | {{#set: smiles=C(=O)([O-])C(=O)CS(=O)(=O)[O-]}} | ||
− | |||
− | |||
{{#set: molecular weight=166.105 }} | {{#set: molecular weight=166.105 }} | ||
+ | {{#set: inchi key=InChIKey=BUTHMSUEBYPMKJ-UHFFFAOYSA-L}} | ||
+ | {{#set: common name=3-sulfopyruvate}} | ||
{{#set: common name=sulfopyruvate|3-Sulfopyruvic acid}} | {{#set: common name=sulfopyruvate|3-Sulfopyruvic acid}} | ||
− | {{#set: reversible reaction associated= | + | {{#set: reversible reaction associated=R230-RXN|RXN-11737}} |
Latest revision as of 16:21, 10 January 2019
Contents
Metabolite CPD-380
- smiles:
- C(=O)([O-])C(=O)CS(=O)(=O)[O-]
- molecular weight:
- 166.105
- inchi key:
- InChIKey=BUTHMSUEBYPMKJ-UHFFFAOYSA-L
- common name:
- 3-sulfopyruvate
- Synonym(s):
- sulfopyruvate
- 3-Sulfopyruvic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])C(=O)CS(=O)(=O)[O-" cannot be used as a page name in this wiki.