Difference between revisions of "4-AMINO-4-DEOXYCHORISMATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-4-DEOXYCHORISMATE 4-AMINO-4-DEOXYCHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C([N+])C...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1) | ** C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 224.193 | ** 224.193 | ||
| + | * inchi key: | ||
| + | ** InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M | ||
| + | * common name: | ||
| + | ** 4-amino-4-deoxychorismate | ||
* Synonym(s): | * Synonym(s): | ||
| Line 14: | Line 14: | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
* [[PABASYN-RXN]] | * [[PABASYN-RXN]] | ||
| + | * [[ADCLY-RXN]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58406 58406] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58406 58406] | ||
| − | * | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266632 45266632] | ||
| + | * CAS : 97279-79-3 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C11355 C11355] | ** [http://www.genome.jp/dbget-bin/www_bget?C11355 C11355] | ||
| + | * BIGG : 4adcho | ||
{{#set: smiles=C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)}} | {{#set: smiles=C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=224.193 }} | {{#set: molecular weight=224.193 }} | ||
| − | {{#set: reversible reaction associated= | + | {{#set: inchi key=InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M}} |
| + | {{#set: common name=4-amino-4-deoxychorismate}} | ||
| + | {{#set: reversible reaction associated=PABASYN-RXN|ADCLY-RXN}} | ||
Latest revision as of 10:59, 10 January 2019
Contents
Metabolite 4-AMINO-4-DEOXYCHORISMATE
- smiles:
- C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)
- molecular weight:
- 224.193
- inchi key:
- InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M
- common name:
- 4-amino-4-deoxychorismate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)" cannot be used as a page name in this wiki.
