Difference between revisions of "CPD-710"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-710 CPD-710] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CC...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) | ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 402.702 | ** 402.702 | ||
| + | * inchi key: | ||
| + | ** InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N | ||
| + | * common name: | ||
| + | ** campestanol | ||
* Synonym(s): | * Synonym(s): | ||
** 5α-campestanol | ** 5α-campestanol | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36799 36799] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36799 36799] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119394 119394] | ||
| + | * REFMET : Campestanol | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C15787 C15787] | ** [http://www.genome.jp/dbget-bin/www_bget?C15787 C15787] | ||
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | {{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=402.702 }} | {{#set: molecular weight=402.702 }} | ||
| + | {{#set: inchi key=InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N}} | ||
| + | {{#set: common name=campestanol}} | ||
{{#set: common name=5α-campestanol}} | {{#set: common name=5α-campestanol}} | ||
{{#set: consumed by=RXN-773}} | {{#set: consumed by=RXN-773}} | ||
Latest revision as of 15:25, 10 January 2019
Contents
Metabolite CPD-710
- smiles:
- CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- molecular weight:
- 402.702
- inchi key:
- InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N
- common name:
- campestanol
- Synonym(s):
- 5α-campestanol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
