Difference between revisions of "CPD-9091"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9091 CPD-9091] == * smiles: ** CC=C5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC=C5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9)))))) | ** CC=C5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9)))))) | ||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 908.494 | ** 908.494 | ||
| + | * common name: | ||
| + | ** bacteriochlorophyll b | ||
* Synonym(s): | * Synonym(s): | ||
| Line 16: | Line 16: | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=122706155 122706155] |
{{#set: smiles=CC=C5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9))))))}} | {{#set: smiles=CC=C5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9))))))}} | ||
| − | |||
{{#set: molecular weight=908.494 }} | {{#set: molecular weight=908.494 }} | ||
| + | {{#set: common name=bacteriochlorophyll b}} | ||
{{#set: produced by=RXN-17482|RXN-17483}} | {{#set: produced by=RXN-17482|RXN-17483}} | ||
Latest revision as of 15:25, 10 January 2019
Contents
Metabolite CPD-9091
- smiles:
- CC=C5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9))))))
- molecular weight:
- 908.494
- common name:
- bacteriochlorophyll b
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC=C5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9))))))" cannot be used as a page name in this wiki.
