Difference between revisions of "CPD-7158"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7158 CPD-7158] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C...") |
|||
Line 2: | Line 2: | ||
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7158 CPD-7158] == | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7158 CPD-7158] == | ||
* smiles: | * smiles: | ||
− | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C(C)C(O)=C( | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C(C)C(O)=C(O)C(OC)=C(O)1) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* molecular weight: | * molecular weight: | ||
** 783.228 | ** 783.228 | ||
+ | * inchi key: | ||
+ | ** InChIKey=ALAJATOGWWBPQT-NSCWJZNLSA-N | ||
+ | * common name: | ||
+ | ** 3-demethylubiquinol-9 | ||
* Synonym(s): | * Synonym(s): | ||
Line 14: | Line 14: | ||
* [[2.1.1.64-RXN]] | * [[2.1.1.64-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84423 84423] | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86583403 86583403] |
− | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C(C)C(O)=C( | + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C(C)C(O)=C(O)C(OC)=C(O)1)}} |
− | + | ||
− | + | ||
{{#set: molecular weight=783.228 }} | {{#set: molecular weight=783.228 }} | ||
+ | {{#set: inchi key=InChIKey=ALAJATOGWWBPQT-NSCWJZNLSA-N}} | ||
+ | {{#set: common name=3-demethylubiquinol-9}} | ||
{{#set: consumed by=2.1.1.64-RXN}} | {{#set: consumed by=2.1.1.64-RXN}} | ||
− |
Latest revision as of 16:26, 10 January 2019
Contents
Metabolite CPD-7158
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C(C)C(O)=C(O)C(OC)=C(O)1)
- molecular weight:
- 783.228
- inchi key:
- InChIKey=ALAJATOGWWBPQT-NSCWJZNLSA-N
- common name:
- 3-demethylubiquinol-9
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links