Difference between revisions of "2-METHYL-BUTYRYL-COA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-BUTYRYL-COA 2-METHYL-BUTYRYL-COA] == * smiles: ** CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ** CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 847.62 | ** 847.62 | ||
| + | * inchi key: | ||
| + | ** InChIKey=LYNVNYDEQMMNMZ-XGXNYEOVSA-J | ||
| + | * common name: | ||
| + | ** 2-methylbutanoyl-CoA | ||
* Synonym(s): | * Synonym(s): | ||
** S-2-methyl-butyryl-CoA | ** S-2-methyl-butyryl-CoA | ||
| Line 20: | Line 20: | ||
* [[DHRT_LPAREN_2mbcoa_RPAREN_]] | * [[DHRT_LPAREN_2mbcoa_RPAREN_]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
* [[2-MEBUCOA-FAD-RXN]] | * [[2-MEBUCOA-FAD-RXN]] | ||
| − | * [[ | + | * [[2KETO-3METHYLVALERATE-RXN]] |
| + | * [[MBCOA-DHLIPOAMIDE-RXN]] | ||
== External links == | == External links == | ||
| + | * REFMET : 2-methylbutanoyl-CoA | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266569 45266569] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266569 45266569] | ||
| Line 33: | Line 33: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C01033 C01033] | ** [http://www.genome.jp/dbget-bin/www_bget?C01033 C01033] | ||
{{#set: smiles=CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | {{#set: smiles=CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=847.62 }} | {{#set: molecular weight=847.62 }} | ||
| + | {{#set: inchi key=InChIKey=LYNVNYDEQMMNMZ-XGXNYEOVSA-J}} | ||
| + | {{#set: common name=2-methylbutanoyl-CoA}} | ||
{{#set: common name=S-2-methyl-butyryl-CoA|2-methylbutyryl-CoA|α-methylbutyryl-CoA|α-methylbutanoyl-CoA}} | {{#set: common name=S-2-methyl-butyryl-CoA|2-methylbutyryl-CoA|α-methylbutyryl-CoA|α-methylbutanoyl-CoA}} | ||
{{#set: consumed by=MCDH_LPAREN_2mb2coa_RPAREN_}} | {{#set: consumed by=MCDH_LPAREN_2mb2coa_RPAREN_}} | ||
{{#set: produced by=DHRT_LPAREN_2mbcoa_RPAREN_}} | {{#set: produced by=DHRT_LPAREN_2mbcoa_RPAREN_}} | ||
| − | {{#set: reversible reaction associated= | + | {{#set: reversible reaction associated=2-MEBUCOA-FAD-RXN|2KETO-3METHYLVALERATE-RXN|MBCOA-DHLIPOAMIDE-RXN}} |
Latest revision as of 11:00, 10 January 2019
Contents
Metabolite 2-METHYL-BUTYRYL-COA
- smiles:
- CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 847.62
- inchi key:
- InChIKey=LYNVNYDEQMMNMZ-XGXNYEOVSA-J
- common name:
- 2-methylbutanoyl-CoA
- Synonym(s):
- S-2-methyl-butyryl-CoA
- 2-methylbutyryl-CoA
- α-methylbutyryl-CoA
- α-methylbutanoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
