Difference between revisions of "CPD-9089"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9089 CPD-9089] == * smiles: ** CCC5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCC5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9)))))) | ** CCC5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9)))))) | ||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 906.478 | ** 906.478 | ||
+ | * common name: | ||
+ | ** phyta-2,10,14-trienyl bacteriochlorophyllide a | ||
* Synonym(s): | * Synonym(s): | ||
** dihydrogeranylgeranyl bacteriochlorophyll a | ** dihydrogeranylgeranyl bacteriochlorophyll a | ||
Line 13: | Line 13: | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
* [[RXN-8789]] | * [[RXN-8789]] | ||
+ | * [[RXN-8790]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=122706411 122706411] |
{{#set: smiles=CCC5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9))))))}} | {{#set: smiles=CCC5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9))))))}} | ||
− | |||
{{#set: molecular weight=906.478 }} | {{#set: molecular weight=906.478 }} | ||
+ | {{#set: common name=phyta-2,10,14-trienyl bacteriochlorophyllide a}} | ||
{{#set: common name=dihydrogeranylgeranyl bacteriochlorophyll a}} | {{#set: common name=dihydrogeranylgeranyl bacteriochlorophyll a}} | ||
− | {{#set: reversible reaction associated=RXN- | + | {{#set: reversible reaction associated=RXN-8789|RXN-8790}} |
Latest revision as of 12:01, 10 January 2019
Contents
Metabolite CPD-9089
- smiles:
- CCC5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9))))))
- molecular weight:
- 906.478
- common name:
- phyta-2,10,14-trienyl bacteriochlorophyllide a
- Synonym(s):
- dihydrogeranylgeranyl bacteriochlorophyll a
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9))))))" cannot be used as a page name in this wiki.