Difference between revisions of "CPD-11938"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11938 CPD-11938] == * smiles: ** C1(OP(=O)([O-])[O-])(C(OP(=O)([O-])[O-])C(OP([O-])(=O)OP([...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(OP(=O)([O-])[O-])(C(OP(=O)([O-])[O-])C(OP([O-])(=O)OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(OP([O-])(=O)[O-])([O-])=O)C(OP([O-])([O-])=O)1) | ** C1(OP(=O)([O-])[O-])(C(OP(=O)([O-])[O-])C(OP([O-])(=O)OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(OP([O-])(=O)[O-])([O-])=O)C(OP([O-])([O-])=O)1) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 805.885 | ** 805.885 | ||
+ | * inchi key: | ||
+ | ** InChIKey=HHQOOERQSFJGEP-SLWYWOEDSA-A | ||
+ | * common name: | ||
+ | ** 1D-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate | ||
* Synonym(s): | * Synonym(s): | ||
** 1,5-bisdiphosphoinositol-1D-myo-inositol (2,3,4,6)tetrakisphosphate | ** 1,5-bisdiphosphoinositol-1D-myo-inositol (2,3,4,6)tetrakisphosphate | ||
Line 15: | Line 15: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
* [[RXN-10974]] | * [[RXN-10974]] | ||
+ | * [[2.7.4.24-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
* [[RXN-10975]] | * [[RXN-10975]] | ||
+ | * [[RXN-10965]] | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74945 74945] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74945 74945] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479488 45479488] | ||
{{#set: smiles=C1(OP(=O)([O-])[O-])(C(OP(=O)([O-])[O-])C(OP([O-])(=O)OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(OP([O-])(=O)[O-])([O-])=O)C(OP([O-])([O-])=O)1)}} | {{#set: smiles=C1(OP(=O)([O-])[O-])(C(OP(=O)([O-])[O-])C(OP([O-])(=O)OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(OP([O-])(=O)[O-])([O-])=O)C(OP([O-])([O-])=O)1)}} | ||
− | |||
− | |||
{{#set: molecular weight=805.885 }} | {{#set: molecular weight=805.885 }} | ||
+ | {{#set: inchi key=InChIKey=HHQOOERQSFJGEP-SLWYWOEDSA-A}} | ||
+ | {{#set: common name=1D-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate}} | ||
{{#set: common name=1,5-bisdiphosphoinositol-1D-myo-inositol (2,3,4,6)tetrakisphosphate|1D-myo-inositol 1-diphosphate pentakisphosphate}} | {{#set: common name=1,5-bisdiphosphoinositol-1D-myo-inositol (2,3,4,6)tetrakisphosphate|1D-myo-inositol 1-diphosphate pentakisphosphate}} | ||
− | {{#set: produced by=2.7.4.24-RXN | + | {{#set: produced by=RXN-10974|2.7.4.24-RXN}} |
− | {{#set: reversible reaction associated=RXN- | + | {{#set: reversible reaction associated=RXN-10975|RXN-10965}} |
Latest revision as of 11:02, 10 January 2019
Contents
Metabolite CPD-11938
- smiles:
- C1(OP(=O)([O-])[O-])(C(OP(=O)([O-])[O-])C(OP([O-])(=O)OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(OP([O-])(=O)[O-])([O-])=O)C(OP([O-])([O-])=O)1)
- molecular weight:
- 805.885
- inchi key:
- InChIKey=HHQOOERQSFJGEP-SLWYWOEDSA-A
- common name:
- 1D-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate
- Synonym(s):
- 1,5-bisdiphosphoinositol-1D-myo-inositol (2,3,4,6)tetrakisphosphate
- 1D-myo-inositol 1-diphosphate pentakisphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(OP(=O)([O-])[O-])(C(OP(=O)([O-])[O-])C(OP([O-])(=O)OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(OP([O-])(=O)[O-])([O-])=O)C(OP([O-])([O-])=O)1)" cannot be used as a page name in this wiki.