Difference between revisions of "CPD-14202"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14202 CPD-14202] == * smiles: ** CC(O)C(O)C2(CNC1(NC(=NC(C=1N=2)=O)N)) * common name: ** L-...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(O)C(O)C2(CNC1(NC(=NC(C=1N=2)=O)N)) | ** CC(O)C(O)C2(CNC1(NC(=NC(C=1N=2)=O)N)) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 239.233 | ** 239.233 | ||
| + | * inchi key: | ||
| + | ** InChIKey=FEMXZDUTFRTWPE-DZSWIPIPSA-N | ||
| + | * common name: | ||
| + | ** L-erythro-7,8-dihydrobiopterin | ||
* Synonym(s): | * Synonym(s): | ||
** L-erythro-q-dihydrobiopterin | ** L-erythro-q-dihydrobiopterin | ||
| Line 14: | Line 14: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-7908]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
* [[SEPIAPTERIN-REDUCTASE-RXN]] | * [[SEPIAPTERIN-REDUCTASE-RXN]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=43029 43029] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=43029 43029] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119055 119055] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119055 119055] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C02953 C02953] | ||
{{#set: smiles=CC(O)C(O)C2(CNC1(NC(=NC(C=1N=2)=O)N))}} | {{#set: smiles=CC(O)C(O)C2(CNC1(NC(=NC(C=1N=2)=O)N))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=239.233 }} | {{#set: molecular weight=239.233 }} | ||
| + | {{#set: inchi key=InChIKey=FEMXZDUTFRTWPE-DZSWIPIPSA-N}} | ||
| + | {{#set: common name=L-erythro-7,8-dihydrobiopterin}} | ||
{{#set: common name=L-erythro-q-dihydrobiopterin}} | {{#set: common name=L-erythro-q-dihydrobiopterin}} | ||
| + | {{#set: produced by=RXN-7908}} | ||
{{#set: reversible reaction associated=SEPIAPTERIN-REDUCTASE-RXN}} | {{#set: reversible reaction associated=SEPIAPTERIN-REDUCTASE-RXN}} | ||
Latest revision as of 11:02, 10 January 2019
Contents
Metabolite CPD-14202
- smiles:
- CC(O)C(O)C2(CNC1(NC(=NC(C=1N=2)=O)N))
- molecular weight:
- 239.233
- inchi key:
- InChIKey=FEMXZDUTFRTWPE-DZSWIPIPSA-N
- common name:
- L-erythro-7,8-dihydrobiopterin
- Synonym(s):
- L-erythro-q-dihydrobiopterin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
