Difference between revisions of "CPD-14158"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14158 CPD-14158] == * smiles: ** C([N+])C1(C(CC(C(O1)OC2(C(C(C([N+])CC([N+])2)OC3(OC(C(C(C(...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C([N+])C1(C(CC(C(O1)OC2(C(C(C([N+])CC([N+])2)OC3(OC(C(C(C(O)3)[N+])O)COC(=O)N))O))[N+])O) | ** C([N+])C1(C(CC(C(O1)OC2(C(C(C([N+])CC([N+])2)OC3(OC(C(C(C(O)3)[N+])O)COC(=O)N))O))[N+])O) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 515.583 | ** 515.583 | ||
| + | * inchi key: | ||
| + | ** InChIKey=YPPFEJHOHNPKLT-PBSUHMDJSA-S | ||
| + | * common name: | ||
| + | ** nebramycin 5' | ||
* Synonym(s): | * Synonym(s): | ||
** nebramycin factor 5' | ** nebramycin factor 5' | ||
| Line 20: | Line 20: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73679 73679] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73679 73679] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71464568 71464568] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C18001 C18001] | ** [http://www.genome.jp/dbget-bin/www_bget?C18001 C18001] | ||
{{#set: smiles=C([N+])C1(C(CC(C(O1)OC2(C(C(C([N+])CC([N+])2)OC3(OC(C(C(C(O)3)[N+])O)COC(=O)N))O))[N+])O)}} | {{#set: smiles=C([N+])C1(C(CC(C(O1)OC2(C(C(C([N+])CC([N+])2)OC3(OC(C(C(C(O)3)[N+])O)COC(=O)N))O))[N+])O)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=515.583 }} | {{#set: molecular weight=515.583 }} | ||
| + | {{#set: inchi key=InChIKey=YPPFEJHOHNPKLT-PBSUHMDJSA-S}} | ||
| + | {{#set: common name=nebramycin 5'}} | ||
{{#set: common name=nebramycin factor 5'|nebramycin V'|6''-O-carbamoyltobramycin}} | {{#set: common name=nebramycin factor 5'|nebramycin V'|6''-O-carbamoyltobramycin}} | ||
{{#set: produced by=RXN-13168|RXN-15284}} | {{#set: produced by=RXN-13168|RXN-15284}} | ||
Latest revision as of 11:05, 10 January 2019
Contents
Metabolite CPD-14158
- smiles:
- C([N+])C1(C(CC(C(O1)OC2(C(C(C([N+])CC([N+])2)OC3(OC(C(C(C(O)3)[N+])O)COC(=O)N))O))[N+])O)
- molecular weight:
- 515.583
- inchi key:
- InChIKey=YPPFEJHOHNPKLT-PBSUHMDJSA-S
- common name:
- nebramycin 5'
- Synonym(s):
- nebramycin factor 5'
- nebramycin V'
- 6-O-carbamoyltobramycin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([N+])C1(C(CC(C(O1)OC2(C(C(C([N+])CC([N+])2)OC3(OC(C(C(C(O)3)[N+])O)COC(=O)N))O))[N+])O)" cannot be used as a page name in this wiki.
