Difference between revisions of "CPD-4822"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4822 CPD-4822] == * smiles: ** C([N+])C1(C(O)C(O)C([N+])C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(CO)...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C([N+])C1(C(O)C(O)C([N+])C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(CO)C(O)C([N+])C(O)3))[N+])) | ** C([N+])C1(C(O)C(O)C([N+])C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(CO)C(O)C([N+])C(O)3))[N+])) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 488.557 | ** 488.557 | ||
| + | * inchi key: | ||
| + | ** InChIKey=SKKLOUVUUNMCJE-FQSMHNGLSA-S | ||
| + | * common name: | ||
| + | ** kanamycin B | ||
* Synonym(s): | * Synonym(s): | ||
** nebramycin factor 5 | ** nebramycin factor 5 | ||
| Line 15: | Line 15: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
* [[RXN-14553]] | * [[RXN-14553]] | ||
| + | * [[RXN-15287]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58549 58549] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58549 58549] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245850 25245850] | ||
| + | * CAS : 4696-76-8 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C00825 C00825] | ** [http://www.genome.jp/dbget-bin/www_bget?C00825 C00825] | ||
| + | * GO-TERMS : (REFMET "Kanamycin B" NIL midford 3701443689 NIL NIL) | ||
{{#set: smiles=C([N+])C1(C(O)C(O)C([N+])C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(CO)C(O)C([N+])C(O)3))[N+]))}} | {{#set: smiles=C([N+])C1(C(O)C(O)C([N+])C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(CO)C(O)C([N+])C(O)3))[N+]))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=488.557 }} | {{#set: molecular weight=488.557 }} | ||
| + | {{#set: inchi key=InChIKey=SKKLOUVUUNMCJE-FQSMHNGLSA-S}} | ||
| + | {{#set: common name=kanamycin B}} | ||
{{#set: common name=nebramycin factor 5|bekanamycin|kanamycin-B}} | {{#set: common name=nebramycin factor 5|bekanamycin|kanamycin-B}} | ||
| − | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-14553|RXN-15287}} |
Latest revision as of 11:06, 10 January 2019
Contents
Metabolite CPD-4822
- smiles:
- C([N+])C1(C(O)C(O)C([N+])C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(CO)C(O)C([N+])C(O)3))[N+]))
- molecular weight:
- 488.557
- inchi key:
- InChIKey=SKKLOUVUUNMCJE-FQSMHNGLSA-S
- common name:
- kanamycin B
- Synonym(s):
- nebramycin factor 5
- bekanamycin
- kanamycin-B
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CHEBI:
- PUBCHEM:
- CAS : 4696-76-8
- LIGAND-CPD:
- GO-TERMS : (REFMET "Kanamycin B" NIL midford 3701443689 NIL NIL)
"C([N+])C1(C(O)C(O)C([N+])C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(CO)C(O)C([N+])C(O)3))[N+]))" cannot be used as a page name in this wiki.
