Difference between revisions of "CPD-8058"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] == * smiles: ** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)) * common na...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)) | ** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 356.326 | ** 356.326 | ||
| + | * inchi key: | ||
| + | ** InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N | ||
| + | * common name: | ||
| + | ** D-galactosylononitol | ||
* Synonym(s): | * Synonym(s): | ||
** galactosyl sequoyitol | ** galactosyl sequoyitol | ||
| Line 21: | Line 21: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202605 25202605] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202605 25202605] | ||
{{#set: smiles=COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O))}} | {{#set: smiles=COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=356.326 }} | {{#set: molecular weight=356.326 }} | ||
| + | {{#set: inchi key=InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N}} | ||
| + | {{#set: common name=D-galactosylononitol}} | ||
{{#set: common name=galactosyl sequoyitol|O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol}} | {{#set: common name=galactosyl sequoyitol|O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol}} | ||
{{#set: produced by=RXN-8281}} | {{#set: produced by=RXN-8281}} | ||
Latest revision as of 11:11, 10 January 2019
Contents
Metabolite CPD-8058
- smiles:
- COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O))
- molecular weight:
- 356.326
- inchi key:
- InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N
- common name:
- D-galactosylononitol
- Synonym(s):
- galactosyl sequoyitol
- O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
