Difference between revisions of "CPD1F-140"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-140 CPD1F-140] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O))) | ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O))) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 331.388 | ** 331.388 | ||
| + | * inchi key: | ||
| + | ** InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M | ||
| + | * common name: | ||
| + | ** gibberellin A20 | ||
* Synonym(s): | * Synonym(s): | ||
** GA20 | ** GA20 | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27742 27742] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27742 27742] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201798 25201798] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C02035 C02035] | ** [http://www.genome.jp/dbget-bin/www_bget?C02035 C02035] | ||
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))}} | {{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=331.388 }} | {{#set: molecular weight=331.388 }} | ||
| + | {{#set: inchi key=InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M}} | ||
| + | {{#set: common name=gibberellin A20}} | ||
{{#set: common name=GA20}} | {{#set: common name=GA20}} | ||
{{#set: consumed by=RXN-113}} | {{#set: consumed by=RXN-113}} | ||
Latest revision as of 11:29, 10 January 2019
Contents
Metabolite CPD1F-140
- smiles:
- C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
- molecular weight:
- 331.388
- inchi key:
- InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M
- common name:
- gibberellin A20
- Synonym(s):
- GA20
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.
