Difference between revisions of "CPD-18312"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18312 CPD-18312] == * smiles: ** C([O-])(=O)C=CC(=O)NCC([N+])C(N)=O * common name: ** N-3-f...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C([O-])(=O)C=CC(=O)NCC([N+])C(N)=O | ** C([O-])(=O)C=CC(=O)NCC([N+])C(N)=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 201.182 | ** 201.182 | ||
| − | * | + | * inchi key: |
| + | ** InChIKey=UJVDEPTVVYUPMX-QPHDTYRISA-N | ||
| + | * common name: | ||
** N-3-fumaramoyl-L-2,3-diaminopropanoate | ** N-3-fumaramoyl-L-2,3-diaminopropanoate | ||
| + | * Synonym(s): | ||
| + | ** N-3-fumaramoyl-(S)-2,3-diaminopropanoate | ||
** Nβ-fumaramoyl-DAP | ** Nβ-fumaramoyl-DAP | ||
** Nβ-fumaramoyl-2,3-diaminopropanoate | ** Nβ-fumaramoyl-2,3-diaminopropanoate | ||
| Line 17: | Line 17: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
* [[RXN-16293]] | * [[RXN-16293]] | ||
| + | * [[RXN-16292]] | ||
| + | * [[RXN-16291]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| Line 26: | Line 26: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86583464 86583464] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86583464 86583464] | ||
{{#set: smiles=C([O-])(=O)C=CC(=O)NCC([N+])C(N)=O}} | {{#set: smiles=C([O-])(=O)C=CC(=O)NCC([N+])C(N)=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=201.182 }} | {{#set: molecular weight=201.182 }} | ||
| − | {{#set: common name=N-3-fumaramoyl-L-2,3-diaminopropanoate|Nβ-fumaramoyl-DAP|Nβ-fumaramoyl-2,3-diaminopropanoate|N-3-fumaramoyl-L-2,3-diaminopropanoic acid|3-{[(2E)-4-amino-4-oxobut-2-enoyl]amino}-L-alanine}} | + | {{#set: inchi key=InChIKey=UJVDEPTVVYUPMX-QPHDTYRISA-N}} |
| − | {{#set: consumed by=RXN- | + | {{#set: common name=N-3-fumaramoyl-L-2,3-diaminopropanoate}} |
| + | {{#set: common name=N-3-fumaramoyl-(S)-2,3-diaminopropanoate|Nβ-fumaramoyl-DAP|Nβ-fumaramoyl-2,3-diaminopropanoate|N-3-fumaramoyl-L-2,3-diaminopropanoic acid|3-{[(2E)-4-amino-4-oxobut-2-enoyl]amino}-L-alanine}} | ||
| + | {{#set: consumed by=RXN-16293|RXN-16292|RXN-16291}} | ||
Latest revision as of 11:39, 10 January 2019
Contents
Metabolite CPD-18312
- smiles:
- C([O-])(=O)C=CC(=O)NCC([N+])C(N)=O
- molecular weight:
- 201.182
- inchi key:
- InChIKey=UJVDEPTVVYUPMX-QPHDTYRISA-N
- common name:
- N-3-fumaramoyl-L-2,3-diaminopropanoate
- Synonym(s):
- N-3-fumaramoyl-(S)-2,3-diaminopropanoate
- Nβ-fumaramoyl-DAP
- Nβ-fumaramoyl-2,3-diaminopropanoate
- N-3-fumaramoyl-L-2,3-diaminopropanoic acid
- 3-{[(2E)-4-amino-4-oxobut-2-enoyl]amino}-L-alanine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C([O-])(=O)C=CC(=O)NCC([N+])C(N)=O" cannot be used as a page name in this wiki.
"3-{[(2E)-4-amino-4-oxobut-2-enoyl]amino}-L-alanine" cannot be used as a page name in this wiki.
