Difference between revisions of "CPD-12019"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12019 CPD-12019] == * smiles: ** COC2(C=CC1(=C(C(CC=O)=CN1)C=2)) * common name: ** 5-methox...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** COC2(C=CC1(=C(C(CC=O)=CN1)C=2)) | ** COC2(C=CC1(=C(C(CC=O)=CN1)C=2)) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 189.213 | ** 189.213 | ||
| + | * inchi key: | ||
| + | ** InChIKey=XVHHCGDXCDKKLH-UHFFFAOYSA-N | ||
| + | * common name: | ||
| + | ** 5-methoxyindoleacetaldehyde | ||
* Synonym(s): | * Synonym(s): | ||
| Line 19: | Line 19: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479662 45479662] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479662 45479662] | ||
{{#set: smiles=COC2(C=CC1(=C(C(CC=O)=CN1)C=2))}} | {{#set: smiles=COC2(C=CC1(=C(C(CC=O)=CN1)C=2))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=189.213 }} | {{#set: molecular weight=189.213 }} | ||
| + | {{#set: inchi key=InChIKey=XVHHCGDXCDKKLH-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=5-methoxyindoleacetaldehyde}} | ||
{{#set: produced by=RXN-11067}} | {{#set: produced by=RXN-11067}} | ||
Latest revision as of 12:44, 10 January 2019
Contents
Metabolite CPD-12019
- smiles:
- COC2(C=CC1(=C(C(CC=O)=CN1)C=2))
- molecular weight:
- 189.213
- inchi key:
- InChIKey=XVHHCGDXCDKKLH-UHFFFAOYSA-N
- common name:
- 5-methoxyindoleacetaldehyde
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
