Difference between revisions of "CPD-12565"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12565 CPD-12565] == * smiles: ** CC(=O)NC1(C(O)OC(COS(=O)(=O)[O-])C(O)C(O)1) * common name:...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=O)NC1(C(O)OC(COS(=O)(=O)[O-])C(O)C(O)1) | ** CC(=O)NC1(C(O)OC(COS(=O)(=O)[O-])C(O)C(O)1) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 300.26 | ** 300.26 | ||
+ | * inchi key: | ||
+ | ** InChIKey=WJFVEEAIYIOATH-KEWYIRBNSA-M | ||
+ | * common name: | ||
+ | ** N-acetyl-D-galactosamine 6-O-sulfate | ||
* Synonym(s): | * Synonym(s): | ||
** N-acetyl-D-galactosamine 6-sulfate | ** N-acetyl-D-galactosamine 6-sulfate | ||
Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63270 63270] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63270 63270] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820057 91820057] | ||
{{#set: smiles=CC(=O)NC1(C(O)OC(COS(=O)(=O)[O-])C(O)C(O)1)}} | {{#set: smiles=CC(=O)NC1(C(O)OC(COS(=O)(=O)[O-])C(O)C(O)1)}} | ||
− | |||
− | |||
{{#set: molecular weight=300.26 }} | {{#set: molecular weight=300.26 }} | ||
+ | {{#set: inchi key=InChIKey=WJFVEEAIYIOATH-KEWYIRBNSA-M}} | ||
+ | {{#set: common name=N-acetyl-D-galactosamine 6-O-sulfate}} | ||
{{#set: common name=N-acetyl-D-galactosamine 6-sulfate}} | {{#set: common name=N-acetyl-D-galactosamine 6-sulfate}} | ||
{{#set: produced by=RXN-12177}} | {{#set: produced by=RXN-12177}} |
Latest revision as of 11:46, 10 January 2019
Contents
Metabolite CPD-12565
- smiles:
- CC(=O)NC1(C(O)OC(COS(=O)(=O)[O-])C(O)C(O)1)
- molecular weight:
- 300.26
- inchi key:
- InChIKey=WJFVEEAIYIOATH-KEWYIRBNSA-M
- common name:
- N-acetyl-D-galactosamine 6-O-sulfate
- Synonym(s):
- N-acetyl-D-galactosamine 6-sulfate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)NC1(C(O)OC(COS(=O)(=O)[O-])C(O)C(O)1)" cannot be used as a page name in this wiki.