Difference between revisions of "CPD-9869"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9869 CPD-9869] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CC...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 821.32 | ** 821.32 | ||
+ | * inchi key: | ||
+ | ** InChIKey=LIOKNOIJMJKVCG-RDSVHMIISA-N | ||
+ | * common name: | ||
+ | ** all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 6-decaprenyl-2-methoxy-1,4-benzoquinol |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
* [[RXN-9235]] | * [[RXN-9235]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64180 64180] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64180 64180] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986248 50986248] | ||
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C}} | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C}} | ||
− | |||
− | |||
{{#set: molecular weight=821.32 }} | {{#set: molecular weight=821.32 }} | ||
− | {{#set: common name=2-methoxy-6-decaprenyl-2-methoxy-1,4-benzoquinol}} | + | {{#set: inchi key=InChIKey=LIOKNOIJMJKVCG-RDSVHMIISA-N}} |
+ | {{#set: common name=all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol}} | ||
+ | {{#set: common name=6-decaprenyl-2-methoxy-1,4-benzoquinol}} | ||
{{#set: consumed by=RXN-9235}} | {{#set: consumed by=RXN-9235}} | ||
− |
Latest revision as of 11:40, 10 January 2019
Contents
Metabolite CPD-9869
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C
- molecular weight:
- 821.32
- inchi key:
- InChIKey=LIOKNOIJMJKVCG-RDSVHMIISA-N
- common name:
- all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol
- Synonym(s):
- 6-decaprenyl-2-methoxy-1,4-benzoquinol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links