Difference between revisions of "GLYCYL-PEPTIDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCYL-PEPTIDE GLYCYL-PEPTIDE] == * smiles: ** C(C(NC(C(O)=O)[R])=O)N * common name: ** glycyl-...") |
|||
| Line 8: | Line 8: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.3.1.97-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16462 16462] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16462 16462] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C02038 C02038] | ||
{{#set: smiles=C(C(NC(C(O)=O)[R])=O)N}} | {{#set: smiles=C(C(NC(C(O)=O)[R])=O)N}} | ||
{{#set: common name=glycyl-peptide}} | {{#set: common name=glycyl-peptide}} | ||
| − | {{#set: | + | {{#set: consumed by=2.3.1.97-RXN}} |
Latest revision as of 12:04, 10 January 2019
Contents
Metabolite GLYCYL-PEPTIDE
- smiles:
- C(C(NC(C(O)=O)[R])=O)N
- common name:
- glycyl-peptide
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(NC(C(O)=O)[R])=O)N" cannot be used as a page name in this wiki.
