Difference between revisions of "CPD-4205"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4205 CPD-4205] == * smiles: ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP([O-])([O-])=O)O)O))C=NC=...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP([O-])([O-])=O)O)O))C=NC=23)))C | ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP([O-])([O-])=O)O)O))C=NC=23)))C | ||
+ | * molecular weight: | ||
+ | ** 413.326 | ||
* inchi key: | * inchi key: | ||
** InChIKey=DUISZFLWBAPRBR-SDBHATRESA-L | ** InChIKey=DUISZFLWBAPRBR-SDBHATRESA-L | ||
* common name: | * common name: | ||
** N6-(Δ2-isopentenyl)-adenosine 5'-monophosphate | ** N6-(Δ2-isopentenyl)-adenosine 5'-monophosphate | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
** iPMP | ** iPMP | ||
Line 17: | Line 17: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
* [[RXN-4313]] | * [[RXN-4313]] | ||
* [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]] | * [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]] | ||
+ | * [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN-4307]] | * [[RXN-4307]] | ||
Line 25: | Line 25: | ||
* [[RXN-4311]] | * [[RXN-4311]] | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57526 57526] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57526 57526] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245046 25245046] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C04713 C04713] | ** [http://www.genome.jp/dbget-bin/www_bget?C04713 C04713] | ||
{{#set: smiles=CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP([O-])([O-])=O)O)O))C=NC=23)))C}} | {{#set: smiles=CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP([O-])([O-])=O)O)O))C=NC=23)))C}} | ||
+ | {{#set: molecular weight=413.326 }} | ||
{{#set: inchi key=InChIKey=DUISZFLWBAPRBR-SDBHATRESA-L}} | {{#set: inchi key=InChIKey=DUISZFLWBAPRBR-SDBHATRESA-L}} | ||
{{#set: common name=N6-(Δ2-isopentenyl)-adenosine 5'-monophosphate}} | {{#set: common name=N6-(Δ2-isopentenyl)-adenosine 5'-monophosphate}} | ||
− | |||
{{#set: common name=iPMP|isopentenyladenosine riboside-5'-monophosphate|iPRMP|N6-(dimethylallyl)adenosine 5'-phosphate|isopentenyladenosine-5'-monophosphate}} | {{#set: common name=iPMP|isopentenyladenosine riboside-5'-monophosphate|iPRMP|N6-(dimethylallyl)adenosine 5'-phosphate|isopentenyladenosine-5'-monophosphate}} | ||
− | {{#set: consumed by=RXN-4313-CPD-4205/WATER//CPD- | + | {{#set: consumed by=RXN-4313|RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.|RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.}} |
{{#set: produced by=RXN-4307}} | {{#set: produced by=RXN-4307}} | ||
{{#set: reversible reaction associated=RXN-4311}} | {{#set: reversible reaction associated=RXN-4311}} |
Latest revision as of 13:07, 10 January 2019
Contents
Metabolite CPD-4205
- smiles:
- CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP([O-])([O-])=O)O)O))C=NC=23)))C
- molecular weight:
- 413.326
- inchi key:
- InChIKey=DUISZFLWBAPRBR-SDBHATRESA-L
- common name:
- N6-(Δ2-isopentenyl)-adenosine 5'-monophosphate
- Synonym(s):
- iPMP
- isopentenyladenosine riboside-5'-monophosphate
- iPRMP
- N6-(dimethylallyl)adenosine 5'-phosphate
- isopentenyladenosine-5'-monophosphate
Reaction(s) known to consume the compound
- RXN-4313
- RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.
- RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP([O-])([O-])=O)O)O))C=NC=23)))C" cannot be used as a page name in this wiki.