Difference between revisions of "CPD-9663"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9663 CPD-9663] == * smiles: ** C(O)C1(O)(C(O)C(O)C(O)C(=O)C1) * common name: ** 2-epi-5-epi...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)C1(O)(C(O)C(O)C(O)C(=O)C1) | ** C(O)C1(O)(C(O)C(O)C(O)C(=O)C1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 192.168 | ** 192.168 | ||
| + | * inchi key: | ||
| + | ** InChIKey=JCZFNXYQGNLHDQ-MVIOUDGNSA-N | ||
| + | * common name: | ||
| + | ** 2-epi-5-epi-valiolone | ||
* Synonym(s): | * Synonym(s): | ||
** (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one | ** (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84187 84187] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84187 84187] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201976 25201976] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201976 25201976] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C17691 C17691] | ||
{{#set: smiles=C(O)C1(O)(C(O)C(O)C(O)C(=O)C1)}} | {{#set: smiles=C(O)C1(O)(C(O)C(O)C(O)C(=O)C1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=192.168 }} | {{#set: molecular weight=192.168 }} | ||
| + | {{#set: inchi key=InChIKey=JCZFNXYQGNLHDQ-MVIOUDGNSA-N}} | ||
| + | {{#set: common name=2-epi-5-epi-valiolone}} | ||
{{#set: common name=(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one}} | {{#set: common name=(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one}} | ||
{{#set: produced by=RXN-9140}} | {{#set: produced by=RXN-9140}} | ||
Latest revision as of 12:09, 10 January 2019
Contents
Metabolite CPD-9663
- smiles:
- C(O)C1(O)(C(O)C(O)C(O)C(=O)C1)
- molecular weight:
- 192.168
- inchi key:
- InChIKey=JCZFNXYQGNLHDQ-MVIOUDGNSA-N
- common name:
- 2-epi-5-epi-valiolone
- Synonym(s):
- (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
