Difference between revisions of "CPD-3713"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3713 CPD-3713] == * smiles: ** C(C2(C3(C(C(N1(C(N=C(C=C1)N)=O))O2)OP(=O)([O-])O3)))O * comm...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C2(C3(C(C(N1(C(N=C(C=C1)N)=O))O2)OP(=O)([O-])O3)))O | ** C(C2(C3(C(C(N1(C(N=C(C=C1)N)=O))O2)OP(=O)([O-])O3)))O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 304.176 | ** 304.176 | ||
| + | * inchi key: | ||
| + | ** InChIKey=NMPZCCZXCOMSDQ-XVFCMESISA-M | ||
| + | * common name: | ||
| + | ** cytidine 2',3'-cyclic monophosphate | ||
* Synonym(s): | * Synonym(s): | ||
** 2',3'-cyclic CMP | ** 2',3'-cyclic CMP | ||
| Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.10463760.html 10463760] | ** [http://www.chemspider.com/Chemical-Structure.10463760.html 10463760] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23421172 23421172] | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60877 60877] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60877 60877] | ||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C02354 C02354] | ** [http://www.genome.jp/dbget-bin/www_bget?C02354 C02354] | ||
| + | * BIGG : 23ccmp | ||
{{#set: smiles=C(C2(C3(C(C(N1(C(N=C(C=C1)N)=O))O2)OP(=O)([O-])O3)))O}} | {{#set: smiles=C(C2(C3(C(C(N1(C(N=C(C=C1)N)=O))O2)OP(=O)([O-])O3)))O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=304.176 }} | {{#set: molecular weight=304.176 }} | ||
| + | {{#set: inchi key=InChIKey=NMPZCCZXCOMSDQ-XVFCMESISA-M}} | ||
| + | {{#set: common name=cytidine 2',3'-cyclic monophosphate}} | ||
{{#set: common name=2',3'-cyclic CMP|cyclic cytidine 2',3'-monophosphate}} | {{#set: common name=2',3'-cyclic CMP|cyclic cytidine 2',3'-monophosphate}} | ||
{{#set: consumed by=RXN-12059}} | {{#set: consumed by=RXN-12059}} | ||
Latest revision as of 12:23, 10 January 2019
Contents
Metabolite CPD-3713
- smiles:
- C(C2(C3(C(C(N1(C(N=C(C=C1)N)=O))O2)OP(=O)([O-])O3)))O
- molecular weight:
- 304.176
- inchi key:
- InChIKey=NMPZCCZXCOMSDQ-XVFCMESISA-M
- common name:
- cytidine 2',3'-cyclic monophosphate
- Synonym(s):
- 2',3'-cyclic CMP
- cyclic cytidine 2',3'-monophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C2(C3(C(C(N1(C(N=C(C=C1)N)=O))O2)OP(=O)([O-])O3)))O" cannot be used as a page name in this wiki.
