Difference between revisions of "CPD-8355"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O * common n...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O | ** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 479.593 | ** 479.593 | ||
| + | * inchi key: | ||
| + | ** InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N | ||
| + | * common name: | ||
| + | ** 1-18:1-2-lysophosphatidylethanolamine | ||
* Synonym(s): | * Synonym(s): | ||
** 1-18:1-lysoPE | ** 1-18:1-lysoPE | ||
** 1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine | ** 1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine | ||
| + | ** 1-oleoylglycerophosphoethanolamine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| Line 20: | Line 21: | ||
* [[RXN-15036]] | * [[RXN-15036]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74971 74971] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74971 74971] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=58177709 58177709] | ||
* HMDB : HMDB11506 | * HMDB : HMDB11506 | ||
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O}} | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=479.593 }} | {{#set: molecular weight=479.593 }} | ||
| − | {{#set: common name=1-18:1-lysoPE|1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine}} | + | {{#set: inchi key=InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N}} |
| + | {{#set: common name=1-18:1-2-lysophosphatidylethanolamine}} | ||
| + | {{#set: common name=1-18:1-lysoPE|1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine|1-oleoylglycerophosphoethanolamine}} | ||
{{#set: consumed by=RXN-15035}} | {{#set: consumed by=RXN-15035}} | ||
{{#set: produced by=RXN-15067}} | {{#set: produced by=RXN-15067}} | ||
{{#set: reversible reaction associated=RXN-15036}} | {{#set: reversible reaction associated=RXN-15036}} | ||
Latest revision as of 12:24, 10 January 2019
Contents
Metabolite CPD-8355
- smiles:
- CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O
- molecular weight:
- 479.593
- inchi key:
- InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N
- common name:
- 1-18:1-2-lysophosphatidylethanolamine
- Synonym(s):
- 1-18:1-lysoPE
- 1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine
- 1-oleoylglycerophosphoethanolamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O" cannot be used as a page name in this wiki.
