Difference between revisions of "CPD-13118"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] == * smiles: ** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O) | ** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 587.33 | ** 587.33 | ||
| + | * inchi key: | ||
| + | ** InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L | ||
| + | * common name: | ||
| + | ** GDP-β-L-fucose | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
* [[GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN]] | * [[GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN]] | ||
* [[GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN]] | * [[GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN]] | ||
| + | * [[2.4.1.68-RXN]] | ||
| + | * [[RXN-9463]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
* [[1.1.1.271-RXN]] | * [[1.1.1.271-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
* [[2.4.1.221-RXN]] | * [[2.4.1.221-RXN]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57273 57273] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57273 57273] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244478 25244478] | ||
{{#set: smiles=CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)}} | {{#set: smiles=CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=587.33 }} | {{#set: molecular weight=587.33 }} | ||
| − | {{#set: consumed by= | + | {{#set: inchi key=InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L}} |
| − | {{#set: produced by= | + | {{#set: common name=GDP-β-L-fucose}} |
| − | {{#set: reversible reaction associated= | + | {{#set: consumed by=GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN|GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN|2.4.1.68-RXN|RXN-9463}} |
| + | {{#set: produced by=1.1.1.271-RXN}} | ||
| + | {{#set: reversible reaction associated=2.4.1.221-RXN}} | ||
Latest revision as of 12:27, 10 January 2019
Contents
Metabolite CPD-13118
- smiles:
- CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)
- molecular weight:
- 587.33
- inchi key:
- InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L
- common name:
- GDP-β-L-fucose
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)" cannot be used as a page name in this wiki.
