Difference between revisions of "D-GLT"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] == * smiles: ** C(CCC(C(=O)[O-])[N+])([O-])=O * common name: ** D-glutamate * inch...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(CCC(C(=O)[O-])[N+])([O-])=O | ** C(CCC(C(=O)[O-])[N+])([O-])=O | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 146.122 | ** 146.122 | ||
+ | * inchi key: | ||
+ | ** InChIKey=WHUUTDBJXJRKMK-GSVOUGTGSA-M | ||
+ | * common name: | ||
+ | ** D-glutamate | ||
* Synonym(s): | * Synonym(s): | ||
** D-glutamic acid | ** D-glutamic acid | ||
Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
* [[D-ALANINE-AMINOTRANSFERASE-RXN]] | * [[D-ALANINE-AMINOTRANSFERASE-RXN]] | ||
− | |||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460297 5460297] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460297 5460297] | ||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29986 29986] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29986 29986] | ||
+ | * GO-TERMS : (REFMET "D-Glutamic acid" NIL midford 3701443689 NIL NIL) | ||
+ | * CAS : 6893-26-1 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00217 C00217] | ||
+ | * HMDB : HMDB03339 | ||
* BIGG : glu__D | * BIGG : glu__D | ||
{{#set: smiles=C(CCC(C(=O)[O-])[N+])([O-])=O}} | {{#set: smiles=C(CCC(C(=O)[O-])[N+])([O-])=O}} | ||
− | |||
− | |||
{{#set: molecular weight=146.122 }} | {{#set: molecular weight=146.122 }} | ||
+ | {{#set: inchi key=InChIKey=WHUUTDBJXJRKMK-GSVOUGTGSA-M}} | ||
+ | {{#set: common name=D-glutamate}} | ||
{{#set: common name=D-glutamic acid|D-glu}} | {{#set: common name=D-glutamic acid|D-glu}} | ||
− | {{#set: reversible reaction associated=D-ALANINE-AMINOTRANSFERASE | + | {{#set: reversible reaction associated=D-ALANINE-AMINOTRANSFERASE-RXN}} |
Latest revision as of 13:31, 10 January 2019
Contents
Metabolite D-GLT
- smiles:
- C(CCC(C(=O)[O-])[N+])([O-])=O
- molecular weight:
- 146.122
- inchi key:
- InChIKey=WHUUTDBJXJRKMK-GSVOUGTGSA-M
- common name:
- D-glutamate
- Synonym(s):
- D-glutamic acid
- D-glu
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- CHEBI:
- GO-TERMS : (REFMET "D-Glutamic acid" NIL midford 3701443689 NIL NIL)
- CAS : 6893-26-1
- LIGAND-CPD:
- HMDB : HMDB03339
- BIGG : glu__D
"C(CCC(C(=O)[O-])[N+])([O-])=O" cannot be used as a page name in this wiki.