Difference between revisions of "CPD0-2184"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2184 CPD0-2184] == * smiles: ** C([O-])(=O)C=CC(=O)C=CC=C(C([O-])=O)O * common name: ** (2...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C([O-])(=O)C=CC(=O)C=CC=C(C([O-])=O)O | ** C([O-])(=O)C=CC(=O)C=CC=C(C([O-])=O)O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 210.143 | ** 210.143 | ||
| + | * inchi key: | ||
| + | ** InChIKey=WCJYZUFKKTYNLB-ARITWGJRSA-L | ||
| + | * common name: | ||
| + | ** (2Z,4E,7E)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate | ||
* Synonym(s): | * Synonym(s): | ||
** 2-hydroxy-6-oxononatrienedioate | ** 2-hydroxy-6-oxononatrienedioate | ||
| Line 21: | Line 21: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61450 61450] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61450 61450] | ||
| − | * | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54743932 54743932] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C12624 C12624] | ** [http://www.genome.jp/dbget-bin/www_bget?C12624 C12624] | ||
| + | * BIGG : hkntd | ||
{{#set: smiles=C([O-])(=O)C=CC(=O)C=CC=C(C([O-])=O)O}} | {{#set: smiles=C([O-])(=O)C=CC(=O)C=CC=C(C([O-])=O)O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=210.143 }} | {{#set: molecular weight=210.143 }} | ||
| + | {{#set: inchi key=InChIKey=WCJYZUFKKTYNLB-ARITWGJRSA-L}} | ||
| + | {{#set: common name=(2Z,4E,7E)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate}} | ||
{{#set: common name=2-hydroxy-6-oxononatrienedioate|2-hydroxy-6-oxonona-2,4,7-trienedioic acid|2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioic acid|2-hydroxy-6-ketononatrienedioate|2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate}} | {{#set: common name=2-hydroxy-6-oxononatrienedioate|2-hydroxy-6-oxonona-2,4,7-trienedioic acid|2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioic acid|2-hydroxy-6-ketononatrienedioate|2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate}} | ||
{{#set: consumed by=RXN-12070}} | {{#set: consumed by=RXN-12070}} | ||
Latest revision as of 12:36, 10 January 2019
Contents
Metabolite CPD0-2184
- smiles:
- C([O-])(=O)C=CC(=O)C=CC=C(C([O-])=O)O
- molecular weight:
- 210.143
- inchi key:
- InChIKey=WCJYZUFKKTYNLB-ARITWGJRSA-L
- common name:
- (2Z,4E,7E)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate
- Synonym(s):
- 2-hydroxy-6-oxononatrienedioate
- 2-hydroxy-6-oxonona-2,4,7-trienedioic acid
- 2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioic acid
- 2-hydroxy-6-ketononatrienedioate
- 2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C=CC(=O)C=CC=C(C([O-])=O)O" cannot be used as a page name in this wiki.
