Difference between revisions of "CPD0-1108"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETYLGLUTKIN-RXN ACETYLGLUTKIN-RXN] == * direction: ** REVERSIBLE * common name: ** acetylglutamat...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETYLGLUTKIN-RXN ACETYLGLUTKIN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1108 CPD0-1108] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** C(C1(C(O)C(O)C(O)O1))O
 +
* molecular weight:
 +
** 150.131   
 +
* inchi key:
 +
** InChIKey=HMFHBZSHGGEWLO-TXICZTDVSA-N
 
* common name:
 
* common name:
** acetylglutamate kinase
+
** β-D-ribofuranose
* ec number:
+
** [http://enzyme.expasy.org/EC/2.7.2.8 EC-2.7.2.8]
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[ATP]][c] '''+''' 1 [[ACETYL-GLU]][c] '''<=>''' 1 [[ADP]][c] '''+''' 1 [[N-ACETYL-GLUTAMYL-P]][c]
+
== Reaction(s) of unknown directionality ==
* With common name(s):
+
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
** 1 ATP[c] '''+''' 1 N-acetyl-L-glutamate[c] '''<=>''' 1 ADP[c] '''+''' 1 N-acetylglutamyl-phosphate[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* Gene: [[SJ09366]]
+
** Source: [[annotation-saccharina_japonica_genome]]
+
*** Assignment: EC-NUMBER
+
** Source: [[orthology-ectocarpus_siliculosus]]
+
** Source: [[orthology-arabidopsis_thaliana]]
+
== Pathways  ==
+
* [[PWY-5154]], L-arginine biosynthesis III (via N-acetyl-L-citrulline): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5154 PWY-5154]
+
** '''8''' reactions found over '''9''' reactions in the full pathway
+
* [[GLUTORN-PWY]], L-ornithine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=GLUTORN-PWY GLUTORN-PWY]
+
** '''5''' reactions found over '''5''' reactions in the full pathway
+
* [[ARGSYNBSUB-PWY]], L-arginine biosynthesis II (acetyl cycle): [http://metacyc.org/META/NEW-IMAGE?object=ARGSYNBSUB-PWY ARGSYNBSUB-PWY]
+
** '''9''' reactions found over '''9''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[orthology]]
+
** Source: [[orthology-arabidopsis_thaliana]]
+
*** Tool: [[pantograph]]
+
** Source: [[orthology-ectocarpus_siliculosus]]
+
*** Tool: [[pantograph]]
+
* Category: [[annotation]]
+
** Source: [[annotation-saccharina_japonica_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* CHEMSPIDER:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14629 14629]
+
** [http://www.chemspider.com/Chemical-Structure.394477.html 394477]
* LIGAND-RXN:
+
* CHEBI:
** [http://www.genome.jp/dbget-bin/www_bget?R02649 R02649]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47002 47002]
* UNIPROT:
+
* LIGAND-CPD:
** [http://www.uniprot.org/uniprot/P54898 P54898]
+
** [http://www.genome.jp/dbget-bin/www_bget?C16639 C16639]
** [http://www.uniprot.org/uniprot/Q9PIR8 Q9PIR8]
+
* PUBCHEM:
** [http://www.uniprot.org/uniprot/Q60382 Q60382]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=447347 447347]
** [http://www.uniprot.org/uniprot/Q9JUK2 Q9JUK2]
+
{{#set: smiles=C(C1(C(O)C(O)C(O)O1))O}}
** [http://www.uniprot.org/uniprot/Q9CHD2 Q9CHD2]
+
{{#set: molecular weight=150.131    }}
** [http://www.uniprot.org/uniprot/Q07905 Q07905]
+
{{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-TXICZTDVSA-N}}
** [http://www.uniprot.org/uniprot/P0A6C8 P0A6C8]
+
{{#set: common name=&beta;-D-ribofuranose}}
** [http://www.uniprot.org/uniprot/Q01217 Q01217]
+
{{#set: reversible reaction associated=RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.}}
** [http://www.uniprot.org/uniprot/P31318 P31318]
+
** [http://www.uniprot.org/uniprot/P69366 P69366]
+
** [http://www.uniprot.org/uniprot/P69365 P69365]
+
** [http://www.uniprot.org/uniprot/P73326 P73326]
+
** [http://www.uniprot.org/uniprot/O50147 O50147]
+
{{#set: direction=REVERSIBLE}}
+
{{#set: common name=acetylglutamate kinase}}
+
{{#set: ec number=EC-2.7.2.8}}
+
{{#set: gene associated=SJ09366}}
+
{{#set: in pathway=PWY-5154|GLUTORN-PWY|ARGSYNBSUB-PWY}}
+
{{#set: reconstruction category=orthology|annotation}}
+
{{#set: reconstruction source=orthology-arabidopsis_thaliana|orthology-ectocarpus_siliculosus|annotation-saccharina_japonica_genome}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 10:32, 10 January 2019

Metabolite CPD0-1108

  • smiles:
    • C(C1(C(O)C(O)C(O)O1))O
  • molecular weight:
    • 150.131
  • inchi key:
    • InChIKey=HMFHBZSHGGEWLO-TXICZTDVSA-N
  • common name:
    • β-D-ribofuranose
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links