Difference between revisions of "CPD-15530"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15530 CPD-15530] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] * common name: ** aldehy...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] | ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 193.133 | ** 193.133 | ||
+ | * inchi key: | ||
+ | ** InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M | ||
+ | * common name: | ||
+ | ** aldehydo-D-glucuronate | ||
* Synonym(s): | * Synonym(s): | ||
** aldehydo-D-glucuronic acid | ** aldehydo-D-glucuronic acid | ||
Line 16: | Line 16: | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47953 47953] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47953 47953] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460126 5460126] | ||
{{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]}} | {{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]}} | ||
− | |||
− | |||
{{#set: molecular weight=193.133 }} | {{#set: molecular weight=193.133 }} | ||
+ | {{#set: inchi key=InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M}} | ||
+ | {{#set: common name=aldehydo-D-glucuronate}} | ||
{{#set: common name=aldehydo-D-glucuronic acid}} | {{#set: common name=aldehydo-D-glucuronic acid}} | ||
{{#set: consumed by=GLUCURONATE-REDUCTASE-RXN}} | {{#set: consumed by=GLUCURONATE-REDUCTASE-RXN}} | ||
− |
Latest revision as of 13:43, 10 January 2019
Contents
Metabolite CPD-15530
- smiles:
- [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]
- molecular weight:
- 193.133
- inchi key:
- InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M
- common name:
- aldehydo-D-glucuronate
- Synonym(s):
- aldehydo-D-glucuronic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.