Difference between revisions of "L-1-GLYCEROPHOSPHORYLETHANOL-AMINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-GLYCEROPHOSPHORYLETHANOL-AMINE L-1-GLYCEROPHOSPHORYLETHANOL-AMINE] == * smiles: ** C(OP([O-...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(OP([O-])(OCC(CO)O)=O)C[N+] | ** C(OP([O-])(OCC(CO)O)=O)C[N+] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 215.142 | ** 215.142 | ||
| + | * inchi key: | ||
| + | ** InChIKey=JZNWSCPGTDBMEW-RXMQYKEDSA-N | ||
| + | * common name: | ||
| + | ** sn-glycero-3-phosphoethanolamine | ||
* Synonym(s): | * Synonym(s): | ||
** L-1-glycerophosphorylethanolamine | ** L-1-glycerophosphorylethanolamine | ||
| Line 19: | Line 19: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678815 70678815] |
| − | * | + | * REFMET : LPE(14:0) |
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16929 16929] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16929 16929] | ||
| + | * HMDB : HMDB00114 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01233 C01233] | ||
* BIGG : g3pe | * BIGG : g3pe | ||
| − | |||
| − | |||
{{#set: smiles=C(OP([O-])(OCC(CO)O)=O)C[N+]}} | {{#set: smiles=C(OP([O-])(OCC(CO)O)=O)C[N+]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=215.142 }} | {{#set: molecular weight=215.142 }} | ||
| + | {{#set: inchi key=InChIKey=JZNWSCPGTDBMEW-RXMQYKEDSA-N}} | ||
| + | {{#set: common name=sn-glycero-3-phosphoethanolamine}} | ||
{{#set: common name=L-1-glycerophosphorylethanolamine|1-glycerophosphorylethanolamine}} | {{#set: common name=L-1-glycerophosphorylethanolamine|1-glycerophosphorylethanolamine}} | ||
{{#set: consumed by=RXN-14160}} | {{#set: consumed by=RXN-14160}} | ||
{{#set: produced by=RXN-15035}} | {{#set: produced by=RXN-15035}} | ||
Latest revision as of 12:47, 10 January 2019
Contents
Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE
- smiles:
- C(OP([O-])(OCC(CO)O)=O)C[N+]
- molecular weight:
- 215.142
- inchi key:
- InChIKey=JZNWSCPGTDBMEW-RXMQYKEDSA-N
- common name:
- sn-glycero-3-phosphoethanolamine
- Synonym(s):
- L-1-glycerophosphorylethanolamine
- 1-glycerophosphorylethanolamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])(OCC(CO)O)=O)C[N+" cannot be used as a page name in this wiki.
