Difference between revisions of "CPD-17757"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17757 CPD-17757] == * smiles: ** CC(=O)NC2(C(O)OC(COS(=O)(=O)[O-])C(O)C(OC1(OC(C([O-])=O)=C...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=O)NC2(C(O)OC(COS(=O)(=O)[O-])C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2) | ** CC(=O)NC2(C(O)OC(COS(=O)(=O)[O-])C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 457.362 | ** 457.362 | ||
| + | * inchi key: | ||
| + | ** InChIKey=BUJZTFINDCQRGP-ZDLRKIOHSA-L | ||
| + | * common name: | ||
| + | ** 4-deoxy-β-D-gluc-4-enuronosyl-(1,3)-N-acetyl--D-glucosamine 6-sulfate | ||
* Synonym(s): | * Synonym(s): | ||
** 4-deoxy-β-D-Δ4-GlcAp-(1→3)-D-GlcNAc6S | ** 4-deoxy-β-D-Δ4-GlcAp-(1→3)-D-GlcNAc6S | ||
| Line 20: | Line 20: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819980 91819980] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819980 91819980] | ||
{{#set: smiles=CC(=O)NC2(C(O)OC(COS(=O)(=O)[O-])C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2)}} | {{#set: smiles=CC(=O)NC2(C(O)OC(COS(=O)(=O)[O-])C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=457.362 }} | {{#set: molecular weight=457.362 }} | ||
| + | {{#set: inchi key=InChIKey=BUJZTFINDCQRGP-ZDLRKIOHSA-L}} | ||
| + | {{#set: common name=4-deoxy-β-D-gluc-4-enuronosyl-(1,3)-N-acetyl--D-glucosamine 6-sulfate}} | ||
{{#set: common name=4-deoxy-β-D-Δ4-GlcAp-(1→3)-D-GlcNAc6S}} | {{#set: common name=4-deoxy-β-D-Δ4-GlcAp-(1→3)-D-GlcNAc6S}} | ||
{{#set: reversible reaction associated=RXN-16512}} | {{#set: reversible reaction associated=RXN-16512}} | ||
Latest revision as of 12:47, 10 January 2019
Contents
Metabolite CPD-17757
- smiles:
- CC(=O)NC2(C(O)OC(COS(=O)(=O)[O-])C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2)
- molecular weight:
- 457.362
- inchi key:
- InChIKey=BUJZTFINDCQRGP-ZDLRKIOHSA-L
- common name:
- 4-deoxy-β-D-gluc-4-enuronosyl-(1,3)-N-acetyl--D-glucosamine 6-sulfate
- Synonym(s):
- 4-deoxy-β-D-Δ4-GlcAp-(1→3)-D-GlcNAc6S
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(=O)NC2(C(O)OC(COS(=O)(=O)[O-])C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2)" cannot be used as a page name in this wiki.
