Difference between revisions of "DUTP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] == * smiles: ** C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O | ** C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 464.112 | ** 464.112 | ||
| + | * inchi key: | ||
| + | ** InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J | ||
| + | * common name: | ||
| + | ** dUTP | ||
* Synonym(s): | * Synonym(s): | ||
** deoxy-UTP | ** deoxy-UTP | ||
| Line 15: | Line 15: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[DUTNH]] | ||
* [[RXN-14199]] | * [[RXN-14199]] | ||
* [[DUTUP]] | * [[DUTUP]] | ||
| + | * [[DUTP-PYROP-RXN]] | ||
* [[DUTCP]] | * [[DUTCP]] | ||
| − | |||
* [[RXN-14219]] | * [[RXN-14219]] | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
* [[DUDPKIN-RXN]] | * [[DUDPKIN-RXN]] | ||
* [[RXN0-724]] | * [[RXN0-724]] | ||
| + | * [[ATDUDm]] | ||
| + | * [[ATDUD]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244408 25244408] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244408 25244408] | ||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61555 61555] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61555 61555] | ||
| + | * GO-TERMS : (REFMET "Deoxyuridine triphosphate" NIL midford 3701443689 NIL NIL) | ||
| + | * CAS : 1173-82-6 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00460 C00460] | ||
| + | * HMDB : HMDB01191 | ||
* BIGG : dutp | * BIGG : dutp | ||
{{#set: smiles=C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}} | {{#set: smiles=C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=464.112 }} | {{#set: molecular weight=464.112 }} | ||
| + | {{#set: inchi key=InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J}} | ||
| + | {{#set: common name=dUTP}} | ||
{{#set: common name=deoxy-UTP|2'-deoxyuridine-5'-triphosphate|deoxyuridine-triphosphate}} | {{#set: common name=deoxy-UTP|2'-deoxyuridine-5'-triphosphate|deoxyuridine-triphosphate}} | ||
| − | {{#set: consumed by=RXN-14199|DUTUP | + | {{#set: consumed by=DUTNH|RXN-14199|DUTUP|DUTP-PYROP-RXN|DUTCP|RXN-14219}} |
| − | {{#set: produced by= | + | {{#set: produced by=DUDPKIN-RXN|RXN0-724|ATDUDm|ATDUD}} |
Latest revision as of 12:48, 10 January 2019
Contents
Metabolite DUTP
- smiles:
- C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
- molecular weight:
- 464.112
- inchi key:
- InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J
- common name:
- dUTP
- Synonym(s):
- deoxy-UTP
- 2'-deoxyuridine-5'-triphosphate
- deoxyuridine-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- CHEBI:
- GO-TERMS : (REFMET "Deoxyuridine triphosphate" NIL midford 3701443689 NIL NIL)
- CAS : 1173-82-6
- LIGAND-CPD:
- HMDB : HMDB01191
- BIGG : dutp
"C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.
