Difference between revisions of "LIPOYL-AMP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIPOYL-AMP LIPOYL-AMP] == * smiles: ** C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))([O-])=O) | ** C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))([O-])=O) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 534.518 | ** 534.518 | ||
+ | * inchi key: | ||
+ | ** InChIKey=QWEGOCJRZOKSOE-ADUAKINBSA-M | ||
+ | * common name: | ||
+ | ** lipoyl-adenylate | ||
* Synonym(s): | * Synonym(s): | ||
** lipoyl-AMP | ** lipoyl-AMP | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
* [[RXN-8655]] | * [[RXN-8655]] | ||
+ | * [[RXN-13039]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN-8654]] | * [[RXN-8654]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83091 83091] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245420 25245420] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245420 25245420] | ||
* HMDB : HMDB59635 | * HMDB : HMDB59635 | ||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C16238 C16238] | ** [http://www.genome.jp/dbget-bin/www_bget?C16238 C16238] | ||
{{#set: smiles=C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))([O-])=O)}} | {{#set: smiles=C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))([O-])=O)}} | ||
− | |||
− | |||
{{#set: molecular weight=534.518 }} | {{#set: molecular weight=534.518 }} | ||
+ | {{#set: inchi key=InChIKey=QWEGOCJRZOKSOE-ADUAKINBSA-M}} | ||
+ | {{#set: common name=lipoyl-adenylate}} | ||
{{#set: common name=lipoyl-AMP}} | {{#set: common name=lipoyl-AMP}} | ||
− | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-8655|RXN-13039}} |
{{#set: produced by=RXN-8654}} | {{#set: produced by=RXN-8654}} |
Latest revision as of 10:45, 10 January 2019
Contents
Metabolite LIPOYL-AMP
- smiles:
- C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))([O-])=O)
- molecular weight:
- 534.518
- inchi key:
- InChIKey=QWEGOCJRZOKSOE-ADUAKINBSA-M
- common name:
- lipoyl-adenylate
- Synonym(s):
- lipoyl-AMP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))([O-])=O)" cannot be used as a page name in this wiki.