Difference between revisions of "CPD-329"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-329 CPD-329] == * smiles: ** C(C(O)[CH]1(OC(=O)C(O)C(=O)1))O * common name: ** L-xylo-hex-3...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C(O)[CH]1(OC(=O)C(O)C(=O)1))O | ** C(C(O)[CH]1(OC(=O)C(O)C(=O)1))O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 176.126 | ** 176.126 | ||
| + | * inchi key: | ||
| + | ** InChIKey=PJBQWWHYTVYMLO-LZUUPNLKSA-N | ||
| + | * common name: | ||
| + | ** L-xylo-hex-3-ulono-1,4-lactone | ||
* Synonym(s): | * Synonym(s): | ||
** L-xylo-hexulonolactone | ** L-xylo-hexulonolactone | ||
| Line 14: | Line 14: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[L-GULONOLACTONE-OXIDASE-RXN]] | * [[L-GULONOLACTONE-OXIDASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73681 73681] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73681 73681] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7048614 7048614] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C03289 C03289] | ** [http://www.genome.jp/dbget-bin/www_bget?C03289 C03289] | ||
{{#set: smiles=C(C(O)[CH]1(OC(=O)C(O)C(=O)1))O}} | {{#set: smiles=C(C(O)[CH]1(OC(=O)C(O)C(=O)1))O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=176.126 }} | {{#set: molecular weight=176.126 }} | ||
| + | {{#set: inchi key=InChIKey=PJBQWWHYTVYMLO-LZUUPNLKSA-N}} | ||
| + | {{#set: common name=L-xylo-hex-3-ulono-1,4-lactone}} | ||
{{#set: common name=L-xylo-hexulonolactone|L-xylo-hex-3-ulonolactone}} | {{#set: common name=L-xylo-hexulonolactone|L-xylo-hex-3-ulonolactone}} | ||
| − | |||
{{#set: produced by=L-GULONOLACTONE-OXIDASE-RXN}} | {{#set: produced by=L-GULONOLACTONE-OXIDASE-RXN}} | ||
Latest revision as of 12:58, 10 January 2019
Contents
Metabolite CPD-329
- smiles:
- C(C(O)[CH]1(OC(=O)C(O)C(=O)1))O
- molecular weight:
- 176.126
- inchi key:
- InChIKey=PJBQWWHYTVYMLO-LZUUPNLKSA-N
- common name:
- L-xylo-hex-3-ulono-1,4-lactone
- Synonym(s):
- L-xylo-hexulonolactone
- L-xylo-hex-3-ulonolactone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(O)[CH]1(OC(=O)C(O)C(=O)1))O" cannot be used as a page name in this wiki.
