Difference between revisions of "CPD-13394"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13394 CPD-13394] == * smiles: ** C([N+])C(=O)NC(C([O-])=O)CCC(=O)N * common name: ** glycyl...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C([N+])C(=O)NC(C([O-])=O)CCC(=O)N | ** C([N+])C(=O)NC(C([O-])=O)CCC(=O)N | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 203.197 | ** 203.197 | ||
+ | * inchi key: | ||
+ | ** InChIKey=PNMUAGGSDZXTHX-BYPYZUCNSA-N | ||
+ | * common name: | ||
+ | ** glycyl-L-glutamine | ||
* Synonym(s): | * Synonym(s): | ||
** gly-gln | ** gly-gln | ||
Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * METABOLIGHTS : MTBLC73898 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7018836 7018836] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7018836 7018836] | ||
+ | * HMDB : HMDB28839 | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74392 74392] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74392 74392] | ||
− | |||
− | |||
{{#set: smiles=C([N+])C(=O)NC(C([O-])=O)CCC(=O)N}} | {{#set: smiles=C([N+])C(=O)NC(C([O-])=O)CCC(=O)N}} | ||
− | |||
− | |||
{{#set: molecular weight=203.197 }} | {{#set: molecular weight=203.197 }} | ||
+ | {{#set: inchi key=InChIKey=PNMUAGGSDZXTHX-BYPYZUCNSA-N}} | ||
+ | {{#set: common name=glycyl-L-glutamine}} | ||
{{#set: common name=gly-gln}} | {{#set: common name=gly-gln}} | ||
{{#set: consumed by=RXN0-6983}} | {{#set: consumed by=RXN0-6983}} |
Latest revision as of 13:01, 10 January 2019
Contents
Metabolite CPD-13394
- smiles:
- C([N+])C(=O)NC(C([O-])=O)CCC(=O)N
- molecular weight:
- 203.197
- inchi key:
- InChIKey=PNMUAGGSDZXTHX-BYPYZUCNSA-N
- common name:
- glycyl-L-glutamine
- Synonym(s):
- gly-gln
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([N+])C(=O)NC(C([O-])=O)CCC(=O)N" cannot be used as a page name in this wiki.